CAS 158755-95-4
:methyl 2-[5-ethyl-2-({4-[3-methyl-2,6-dioxo-4-(trifluoromethyl)-3,6-dihydropyrimidin-1(2H)-yl]phenoxy}methyl)phenoxy]propanoate
Description:
Methyl 2-[5-ethyl-2-({4-[3-methyl-2,6-dioxo-4-(trifluoromethyl)-3,6-dihydropyrimidin-1(2H)-yl]phenoxy}methyl)phenoxy]propanoate, identified by its CAS number 158755-95-4, is a complex organic compound characterized by its intricate molecular structure, which includes multiple functional groups such as esters, aromatic rings, and heterocycles. This compound features a methyl ester group, contributing to its solubility in organic solvents, and a trifluoromethyl group, which can enhance its biological activity and lipophilicity. The presence of pyrimidine and phenoxy moieties suggests potential applications in pharmaceuticals, particularly in drug design, due to their roles in biological interactions. The compound's synthesis likely involves multi-step organic reactions, reflecting its complexity. Additionally, its stability, reactivity, and potential toxicity would need to be evaluated in a laboratory setting to understand its behavior in various environments. Overall, this substance exemplifies the diversity of organic chemistry and its applications in medicinal chemistry and material science.
Formula:C25H25F3N2O6
InChI:InChI=1/C25H25F3N2O6/c1-5-16-6-7-17(20(12-16)36-15(2)23(32)34-4)14-35-19-10-8-18(9-11-19)30-22(31)13-21(25(26,27)28)29(3)24(30)33/h6-13,15H,5,14H2,1-4H3
SMILES:CCc1ccc(COc2ccc(cc2)n2c(=O)cc(C(F)(F)F)n(C)c2=O)c(c1)OC(C)C(=O)OC
Synonyms:- 158755-95-4
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
(±)-Benzfendizone-13C1 (5-ethyl-a-13C)
CAS:Controlled ProductApplications (±)-Benzfendizone-13C1 (5-ethyl-a-13C) is a useful isotopically labeled compound
Formula:CC24H25F3N2O6Color and Shape:NeatMolecular weight:507.47
