CAS 158816-55-8

3,4,5-TRIFLUOROPHENYLACETYLENE

Description:

3,4,5-Trifluorophenylacetylene is an organic compound characterized by the presence of a phenyl ring substituted with three fluorine atoms and an acetylene functional group. Its molecular structure features a phenyl group attached to a terminal alkyne, which contributes to its unique reactivity and properties. The trifluoromethyl substitutions enhance the compound's electron-withdrawing characteristics, influencing its chemical behavior and making it useful in various synthetic applications. This compound is typically a colorless to pale yellow liquid or solid, depending on the temperature and purity. It is known for its stability under standard conditions but may undergo reactions typical of alkynes, such as addition reactions. Additionally, the presence of fluorine atoms can impart increased lipophilicity and alter the compound's solubility in organic solvents. Due to its specific structural features, 3,4,5-trifluorophenylacetylene is of interest in materials science and medicinal chemistry, particularly in the development of fluorinated compounds and potential pharmaceuticals. Safety precautions should be observed when handling this substance, as with many fluorinated organic compounds.

Formula: C₈H₃F₃

InChI: InChI=1/C8H3F3/c1-2-5-3-6(9)8(11)7(10)4-5/h1,3-4H

SMILES: C#Cc1cc(c(c(c1)F)F)F

Synonyms:

• 5-Ethynyl-1,2,3-Trifluoro-Benzene
• Benzene, 5-ethynyl-1,2,3-trifluoro-

5-Ethynyl-1,2,3-trifluorobenzene

CAS: 158816-55-8

Formula: C₈H₃F₃

Purity: >98.0%(GC)

Color and Shape: Colorless to Light orange to Yellow clear liquid

Molecular weight: 156.11

Ref: 3B-E1078

3,4,5-Trifluorophenylacetylene

CAS: 158816-55-8

Formula: C₈H₃F₃

Purity: 97%

Color and Shape: Solid

Molecular weight: 156.1046

Ref: IN-DA003ANE

3,4,5-Trifluorophenylacetylene

CAS: 158816-55-8

3,4,5-Trifluorophenylacetylene

Formula: C₈H₃F₃

Purity: ≥95%

Color and Shape: yellow low melting solid / liquid

Molecular weight: 156.10g/mol

Ref: 54-PC9819

3,4,5-Trifluorophenylacetylene

CAS: 158816-55-8

Formula: C₈H₃F₃

Purity: 97%

Color and Shape: Liquid

Molecular weight: 156.107

Ref: 10-F046096