CAS 1588441-25-1

Spiro[isoquinoline-4(1H),4′-piperidine], 2,3-dihydro-, hydrochloride (1:2)

Description:

Spiro[isoquinoline-4(1H),4′-piperidine], 2,3-dihydro-, hydrochloride (1:2) is a chemical compound characterized by its unique spirocyclic structure, which incorporates both an isoquinoline and a piperidine moiety. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential biological activity. The presence of the hydrochloride indicates that it is a salt form, which often enhances solubility in polar solvents, making it suitable for various applications in pharmaceutical research. The spiro configuration can influence the compound's stereochemistry, potentially affecting its interaction with biological targets. As a dihydro derivative, it may possess reduced aromatic character compared to fully unsaturated analogs, which can impact its reactivity and stability. Overall, this compound's structural features suggest it may be of interest in medicinal chemistry, particularly in the development of novel therapeutic agents. However, specific biological activities and applications would require further investigation through empirical studies.

Formula: C₁₃H₁₈N₂·2ClH

InChI: InChI=1S/C13H18N2.2ClH/c1-2-4-12-11(3-1)9-15-10-13(12)5-7-14-8-6-13;;/h1-4,14-15H,5-10H2;2*1H

InChI key: InChIKey=HTMHZEDALOUSBU-UHFFFAOYSA-N

SMILES: C12(C=3C(CNC1)=CC=CC3)CCNCC2.Cl

Synonyms:

• Spiro[isoquinoline-4(1H),4′-piperidine], 2,3-dihydro-, hydrochloride (1:2)

2,3-Dihydro-1H-spiro[isoquinoline-4,4'-piperidine] dihydrochloride

CAS: 1588441-25-1

Formula: C₁₃H₂₀Cl₂N₂

Purity: 95%

Molecular weight: 275.2173

Ref: IN-DA001QXI

2,3-Dihydro-1H-spiro[isoquinoline-4,4'-piperidine] dihydrochloride

CAS: 1588441-25-1

Purity: 95.0%

Molecular weight: 275.2200012207031

Ref: 10-F334409