CAS 1588441-26-2

2,7-Diazaspiro[3.5]nonane, 7-methyl-, hydrochloride (1:2)

Description:

2,7-Diazaspiro[3.5]nonane, 7-methyl-, hydrochloride (1:2) is a chemical compound characterized by its unique spirocyclic structure, which consists of two nitrogen atoms incorporated into a bicyclic framework. This compound features a methyl group at the 7-position, contributing to its overall molecular complexity and potentially influencing its biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which can enhance its utility in various applications, including pharmaceuticals. The presence of nitrogen atoms in the structure suggests potential interactions with biological systems, making it of interest in medicinal chemistry. The compound may exhibit properties such as basicity due to the nitrogen atoms, and its spirocyclic nature could impart unique conformational characteristics. Overall, 2,7-Diazaspiro[3.5]nonane, 7-methyl-, hydrochloride (1:2) represents a class of compounds that may have diverse applications in drug development and other fields of chemistry.

Formula: C₈H₁₆N₂·2ClH

InChI: InChI=1S/C8H16N2.2ClH/c1-10-4-2-8(3-5-10)6-9-7-8;;/h9H,2-7H2,1H3;2*1H

InChI key: InChIKey=IRAPLIBTHNEENQ-UHFFFAOYSA-N

SMILES: CN1CCC2(CC1)CNC2.Cl

Synonyms:

• 2,7-Diazaspiro[3.5]nonane, 7-methyl-, hydrochloride (1:2)

2,7-Diazaspiro[3.5]nonane, 7-methyl-, hydrochloride (1:2)

CAS: 1588441-26-2

Formula: C₈H₁₈Cl₂N₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 213.1479

Ref: IN-DA001QXH

7-Methyl-2,7-diazaspiro[3.5]nonane dihydrochloride

CAS: 1588441-26-2

7-Methyl-2,7-diazaspiro[3.5]nonane dihydrochloride

Purity: 98%

Color and Shape: Solid

Molecular weight: 213.15g/mol

Ref: 54-OR920868

7-Methyl-2,7-diazaspiro[3.5]nonane dihydrochloride

CAS: 1588441-26-2

7-Methyl-2,7-diazaspiro[3.5]nonane dihydrochloride is a fine chemical that is used as a versatile building block in the synthesis of complex compounds. It has CAS No. 1588441-26-2 and can be used as a research chemical, reagent, or speciality chemical. This compound is useful for the production of high quality and useful intermediates and reaction components. 7-Methyl-2,7-diazaspiro[3.5]nonane dihydrochloride also has scaffold properties that can be used to synthesize other organic molecules with potential use as pharmaceuticals or agrochemicals.

Formula: C₈H₁₆N₂•(HCl)₂

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 213.15 g/mol

Ref: 3D-NNC44126

7-Methyl-2,7-diazaspiro[3.5]nonane dihydrochloride

CAS: 1588441-26-2

Formula: C₈H₁₈Cl₂N₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 213.15

Ref: 10-F334418