
CAS 1588441-37-5
:2-Pyridinecarboxylic acid, 5-methyl-, hydrate (1:1)
Description:
2-Pyridinecarboxylic acid, 5-methyl-, hydrate (1:1), also known as 5-methyl-2-pyridinecarboxylic acid monohydrate, is an organic compound characterized by its pyridine ring structure with a carboxylic acid functional group and a methyl substituent at the 5-position. This compound typically appears as a white to off-white crystalline solid and is soluble in water due to the presence of the carboxylic acid group, which can form hydrogen bonds with water molecules. The hydrate form indicates that it contains one molecule of water for every molecule of the acid, which can influence its physical properties, such as melting point and solubility. It is often used in organic synthesis and may serve as an intermediate in the production of pharmaceuticals or agrochemicals. The compound's reactivity is largely dictated by the functional groups present, allowing for various chemical transformations. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C7H7NO2·H2O
InChI:InChI=1S/C7H7NO2.H2O/c1-5-2-3-6(7(9)10)8-4-5;/h2-4H,1H3,(H,9,10);1H2
InChI key:InChIKey=ZLVGPXMAZOSNRR-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=CC=C(C)C=N1.O
Synonyms:- 2-Pyridinecarboxylic acid, 5-methyl-, hydrate (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
