CymitQuimica logo

CAS 15887-84-0

:

2-[(4-CHLOROBENZYL)SULFANYL]BENZENECARBOXYLIC ACID

Description:
2-[(4-Chlorobenzyl)sulfanyl]benzenecarboxylic acid, with the CAS number 15887-84-0, is an organic compound characterized by the presence of a benzenecarboxylic acid moiety and a sulfanyl group attached to a chlorobenzyl substituent. This compound features a sulfur atom that connects the chlorobenzyl group to the benzenecarboxylic acid, indicating potential reactivity due to the presence of the thiol functional group. The chlorobenzyl group introduces a chlorine atom, which can influence the compound's electronic properties and reactivity. The carboxylic acid functional group contributes to the compound's acidity and solubility in polar solvents. Overall, this compound may exhibit biological activity, making it of interest in medicinal chemistry and pharmaceutical research. Its structural features suggest potential applications in drug development, particularly in the design of compounds with specific interactions in biological systems. As with many organic compounds, its stability, reactivity, and potential applications would depend on the specific conditions under which it is used.
Formula:C14H10ClO2S
InChI:InChI=1/C14H11ClO2S/c15-11-7-5-10(6-8-11)9-18-13-4-2-1-3-12(13)14(16)17/h1-8H,9H2,(H,16,17)/p-1
SMILES:c1ccc(c(c1)C(=O)[O-])SCc1ccc(cc1)Cl
Synonyms:
  • 2-[(4-Chlorobenzyl)Sulfanyl]Benzoic Acid
  • 2-[(4-Chlorobenzyl)Sulfanyl]Benzoate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.