CAS 158876-66-5

7-(4-FLUOROPHENYL)-1,2,3,4-TETRAHYDRO-2-(OXOPHENYLACETYL)-8-(4-PYRIDINYL)-PYRAZOLO[5,1-C][1,2,4]TRIAZINE SULFATE

Description:

7-(4-Fluorophenyl)-1,2,3,4-tetrahydro-2-(oxophenylacetyl)-8-(4-pyridinyl)-pyrazolo[5,1-c][1,2,4]triazine sulfate is a complex organic compound characterized by its multi-ring structure, which includes a pyrazolo-triazine core. This compound features various functional groups, including a fluorophenyl moiety and a pyridinyl group, contributing to its potential biological activity. The presence of the sulfate group indicates that it may exhibit solubility in water, which is often advantageous for pharmacological applications. The compound's structure suggests potential interactions with biological targets, making it of interest in medicinal chemistry. Its unique arrangement of atoms and functional groups may influence its reactivity, stability, and bioactivity, which are critical for its application in drug development. As with many complex organic molecules, the specific characteristics, such as melting point, solubility, and spectral properties, would require empirical determination through experimental methods. Overall, this compound represents a class of heterocyclic compounds that may have significant implications in therapeutic research.

Formula: C₂₄H₂₀FN₅O₆S

InChI: InChI=1/C24H18FN5O2.H2O4S/c25-19-8-6-17(7-9-19)21-20(16-10-12-26-13-11-16)23-28-30(15-14-29(23)27-21)24(32)22(31)18-4-2-1-3-5-18;1-5(2,3)4/h1-13,28H,14-15H2;(H2,1,2,3,4)

SMILES: c1ccc(cc1)C(=O)C(=O)N1CCn2c(c(c3ccncc3)c(c3ccc(cc3)F)n2)N1.OS(=O)(=O)O

Synonyms:

• Fr 167653
• 2-[7-(4-fluorophenyl)-8-pyridin-4-yl-3,4-dihydropyrazolo[5,1-c][1,2,4]triazin-2(1H)-yl]-2-oxo-1-phenylethanone sulfate

1-(7-(4-Fluorophenyl)-8-(pyridin-4-yl)-3,4-dihydropyrazolo[5,1-c][1,2,4]triazin-2(1H)-yl)-2-phenylethane-1,2-dione sulfate

CAS: 158876-66-5

Formula: C₂₄H₂₀FN₅O₆S

Purity: 99.87%

Molecular weight: 525.5089

Ref: IN-DA001QYX

FR 167653

CAS: 158876-66-5

FR 167653 sulfate, an orally active and selective inhibitor of p38 MAPK, is effective in treating inflammation, trauma, and ischemia-reperfusion injury in vivo. It acts as a potent suppressor of TNF-α and IL-1β production through specific inhibition of p38 MAPK activity.

Formula: C₂₄H₂₀FN₅O₆S

Purity: 98%

Color and Shape: Solid

Molecular weight: 525.51

Ref: TM-T11327