CAS 158878-54-7

Pyridine, 1,2,3,6-tetrahydro-5-phenyl-, hydrochloride (1:1)

Description:

Pyridine, 1,2,3,6-tetrahydro-5-phenyl-, hydrochloride (1:1) is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This specific compound is a hydrochloride salt, indicating that it is formed by the reaction of the base with hydrochloric acid, resulting in improved solubility in water. The tetrahydro form suggests that four of the carbon atoms in the pyridine ring are saturated, contributing to its stability and altering its reactivity compared to fully aromatic pyridine. The presence of a phenyl group enhances its potential for various chemical interactions and applications, particularly in organic synthesis and medicinal chemistry. As a hydrochloride, it typically appears as a crystalline solid and is often used in pharmaceutical formulations. Safety data should be consulted for handling and storage, as with many nitrogen-containing heterocycles, it may exhibit biological activity and potential toxicity.

Formula: C₁₁H₁₃N·ClH

InChI: InChI=1S/C11H13N.ClH/c1-2-5-10(6-3-1)11-7-4-8-12-9-11;/h1-3,5-7,12H,4,8-9H2;1H

InChI key: InChIKey=AERNNJNTNZDJDC-UHFFFAOYSA-N

SMILES: C1(=CC=CC=C1)C2=CCCNC2.Cl

Synonyms:

• Pyridine, 1,2,3,6-tetrahydro-5-phenyl-, hydrochloride
• Pyridine, 1,2,3,6-tetrahydro-5-phenyl-, hydrochloride (1:1)

5-Phenyl-1,2,3,6-tetrahydropyridine hydrochloride

CAS: 158878-54-7

Versatile small molecule scaffold

Formula: C₁₁H₁₄ClN

Purity: Min. 95%

Molecular weight: 195.69 g/mol

Ref: 3D-IGA87854