CAS 1589-61-3
:Cyclohexanone, semicarbazone
Description:
Cyclohexanone semicarbazone is an organic compound formed by the reaction of cyclohexanone with semicarbazide. It is characterized by its crystalline solid form, typically appearing as white to off-white crystals. This compound is notable for its role in organic synthesis and analytical chemistry, particularly in the identification and characterization of ketones. Cyclohexanone semicarbazone exhibits moderate solubility in polar solvents such as ethanol and methanol, while being less soluble in non-polar solvents. The compound has a melting point that can vary based on purity and specific conditions. Its structure features a semicarbazone functional group, which contributes to its reactivity and ability to form derivatives. Cyclohexanone semicarbazone can be used in various applications, including as a reagent in the synthesis of other organic compounds and in the study of reaction mechanisms. Safety precautions should be taken when handling this compound, as it may pose health risks if ingested or inhaled, and appropriate protective equipment should be used.
Formula:C7H13N3O
InChI:InChI=1S/C7H13N3O/c8-7(11)10-9-6-4-2-1-3-5-6/h1-5H2,(H3,8,10,11)
InChI key:InChIKey=KZDDDHJBINUIKQ-UHFFFAOYSA-N
SMILES:N(NC(N)=O)=C1CCCCC1
Synonyms:- (Cyclohexylideneamino)urea
- 2-Cyclohexylidenehydrazinecarboxamide
- Ai3-01546
- Brn 2046654
- Cyclohexanone semicarbazide
- Cyclohexanone, semicarbazone
- Hydrazinecarboxamide, 2-cyclohexylidene-
- Nsc 37557
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2-Cyclohexylidenehydrazinecarboxamide
CAS:Controlled ProductFormula:C7H13N3OColor and Shape:NeatMolecular weight:155.198
