CAS 15890-40-1
:(1R,3R)-1,2,3-trimethylcyclopentane
Description:
(1R,3R)-1,2,3-trimethylcyclopentane is a cyclic hydrocarbon characterized by a cyclopentane ring with three methyl groups attached at the 1, 2, and 3 positions. This compound is a stereoisomer, specifically one of the chiral forms, due to the presence of asymmetric carbon atoms. Its molecular formula is C8H16, indicating it is a saturated hydrocarbon with no double or triple bonds. The presence of multiple methyl groups contributes to its branched structure, which can influence its physical properties, such as boiling point and melting point, compared to its linear counterparts. The compound is typically colorless and has a characteristic hydrocarbon odor. It is non-polar, making it insoluble in water but soluble in organic solvents. (1R,3R)-1,2,3-trimethylcyclopentane is of interest in organic chemistry and may be used in various applications, including as a solvent or in the synthesis of more complex organic molecules. Its stereochemistry can also play a role in its reactivity and interactions with other chemical species.
Formula:C8H16
InChI:InChI=1/C8H16/c1-6-4-5-7(2)8(6)3/h6-8H,4-5H2,1-3H3/t6-,7-/m1/s1
SMILES:C[C@@H]1CC[C@@H](C)C1C
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
cis-1,2-trans-3-Trimethylcyclopentane (Relative Stereochemistry)
CAS:Controlled ProductApplications cis-1,2-trans-3-Trimethylcyclopentane (Relative Stereochemistry) is a building block used for the synthesis of some chemical compounds. It is a component of gasoline.
Not a dangerous good if item is equal to or less than 1g/ml and there is less than 100g/ml in the package
References Bryanskaya, E. K., et al.: Neftekhimiya, 6, 904 (1966);Formula:C8H16Color and Shape:NeatMolecular weight:112.213
