CAS 15890-40-1: (1R,3R)-1,2,3-trimethylcyclopentane

Description:(1R,3R)-1,2,3-trimethylcyclopentane is a cyclic hydrocarbon characterized by a cyclopentane ring with three methyl groups attached at the 1, 2, and 3 positions. This compound is a stereoisomer, specifically one of the chiral forms, due to the presence of asymmetric carbon atoms. Its molecular formula is C8H16, indicating it is a saturated hydrocarbon with no double or triple bonds. The presence of multiple methyl groups contributes to its branched structure, which can influence its physical properties, such as boiling point and melting point, compared to its linear counterparts. The compound is typically colorless and has a characteristic hydrocarbon odor. It is non-polar, making it insoluble in water but soluble in organic solvents. (1R,3R)-1,2,3-trimethylcyclopentane is of interest in organic chemistry and may be used in various applications, including as a solvent or in the synthesis of more complex organic molecules. Its stereochemistry can also play a role in its reactivity and interactions with other chemical species.

Formula:C₈H₁₆

InChI:InChI=1/C8H16/c1-6-4-5-7(2)8(6)3/h6-8H,4-5H2,1-3H3/t6-,7-/m1/s1

Found 2 products.

Brand	Product data	Purity	Price range	Estimated delivery
	cis-1,2-trans-3-Trimethylcyclopentane (Relative Stereochemistry) REF: TR-T796205CAS: 15890-40-1	- - -	14,631.00 €	Tue 10 Jun 25
	Cis-1,2-trans-3-trimethylcyclopentane (relative stereochemistry) REF: 3D-QAA89040CAS: 15890-40-1	Min. 95%	- - -	Discontinued product