CAS 158906-40-2
:2,3-Dihydro-3-methyl-1,2,6,7-tetrahydroxy-1H-benzo(a)fluorene-4,11-dio ne
Description:
2,3-Dihydro-3-methyl-1,2,6,7-tetrahydroxy-1H-benzo(a)fluorene-4,11-dione, with CAS number 158906-40-2, is a polycyclic aromatic compound characterized by its complex structure, which includes multiple hydroxyl groups and a dione functional group. This compound features a fused ring system typical of benzo(a)fluorene derivatives, contributing to its potential biological activity and chemical reactivity. The presence of hydroxyl groups suggests that it may exhibit hydrogen bonding capabilities, influencing its solubility and interaction with other molecules. Additionally, the dione functionality indicates potential for redox activity, making it a candidate for various chemical reactions. Its structural features may also impart unique optical properties, which could be relevant in applications such as fluorescence or photochemistry. Overall, this compound's intricate arrangement of functional groups and rings positions it as a subject of interest in both synthetic chemistry and potential pharmacological studies.
Formula:C18H14O6
InChI:InChI=1/C18H14O6/c1-6-15(21)8-5-10(20)13-11-7(3-2-4-9(11)19)17(23)14(13)12(8)18(24)16(6)22/h2-6,16,18-20,22,24H,1H3
Synonyms:- 2,3-Dihydro-3-methyl-1,2,6,7-tetrahydroxy-1H-benzo(a)fluorene-4,11-dione
- 1H-Benzo(a)fluorene-4,11-dione, 2,3-dihydro-3-methyl-1,2,6,7-tetrahydroxy-
- Fluostatin b
- 1,2,6,7-tetrahydroxy-3-methyl-2,3-dihydro-1H-benzo[a]fluorene-4,11-dione
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Fluostatin B
CAS:Fluostatin B, a fluorenone discovered in Streptomyces, is an inhibitor of dipeptidyl peptidase 3 (DPP-3; IC50= 24 µg/ml).Formula:C18H14O6Color and Shape:SolidMolecular weight:326.3

