CAS 158918-49-1

4-Methylbenzenesulfonic acid 2-[(2-bromophenyl)methylene]hydrazide

Description:

4-Methylbenzenesulfonic acid 2-[(2-bromophenyl)methylene]hydrazide, identified by its CAS number 158918-49-1, is a chemical compound that features a sulfonic acid group and a hydrazide functional group. This compound is characterized by its aromatic structure, which includes a methyl group and a bromophenyl moiety, contributing to its chemical reactivity and potential applications in organic synthesis. The presence of the sulfonic acid group enhances its solubility in polar solvents, making it useful in various chemical reactions and processes. Additionally, the hydrazide functionality can participate in condensation reactions, potentially leading to the formation of more complex molecules. The compound may exhibit biological activity, which could be of interest in pharmaceutical research. Its specific properties, such as melting point, boiling point, and reactivity, would typically be determined through experimental methods and may vary based on purity and environmental conditions. Overall, this compound represents a versatile building block in organic chemistry with potential applications in both industrial and research settings.

Formula: C₁₄H₁₃BrN₂O₂S

InChI: InChI=1S/C14H13BrN2O2S/c1-11-6-8-13(9-7-11)20(18,19)17-16-10-12-4-2-3-5-14(12)15/h2-10,17H,1H3

InChI key: InChIKey=GHQRHGNPHYRGPB-UHFFFAOYSA-N

SMILES: S(NN=CC1=C(Br)C=CC=C1)(=O)(=O)C2=CC=C(C)C=C2

Synonyms:

• Benzenesulfonic acid, 4-methyl-, [(2-bromophenyl)methylene]hydrazide
• Benzenesulfonic acid, 4-methyl-, 2-[(2-bromophenyl)methylene]hydrazide
• 2-Bromobenzaldehyde p-toluenesulfonylhydrazone
• 4-Methylbenzenesulfonic acid 2-[(2-bromophenyl)methylene]hydrazide
• 4-Methylbenzenesulfonic acid [(2-bromophenyl)methylene]hydrazide

Benzenesulfonic acid, 4-methyl-, 2-[(2-bromophenyl)methylene]hydrazide

CAS: 158918-49-1

Formula: C₁₄H₁₃BrN₂O₂S

Purity: 95%

Molecular weight: 353.2342

Ref: IN-DA01Q1DS