CAS 158932-00-4
:Boc-D-Tryptophanol
Description:
Boc-D-Tryptophanol, with the CAS number 158932-00-4, is a derivative of tryptophan, an essential amino acid. It features a tert-butyloxycarbonyl (Boc) protecting group, which is commonly used in peptide synthesis to protect the amino group of the amino acid. This compound is characterized by its aromatic indole side chain, which contributes to its biochemical properties and potential applications in pharmaceuticals and biochemistry. Boc-D-Tryptophanol is typically utilized in the synthesis of peptides and other complex organic molecules, allowing for the selective modification of the tryptophan residue. The presence of the Boc group enhances the stability of the amino acid during chemical reactions, facilitating the formation of peptide bonds. Additionally, the compound may exhibit unique biological activities due to the tryptophan moiety, which is known for its role in neurotransmitter synthesis and other physiological functions. Overall, Boc-D-Tryptophanol serves as a valuable intermediate in organic synthesis and medicinal chemistry.
Formula:C16H22N2O3
InChI:InChI=1/C16H22N2O3/c1-16(2,3)21-15(20)18-12(10-19)8-11-9-17-14-7-5-4-6-13(11)14/h4-7,9,12,17,19H,8,10H2,1-3H3,(H,18,20)/t12-/m1/s1
SMILES:CC(C)(C)OC(=N[C@H](Cc1c[nH]c2ccccc12)CO)O
Synonyms:- Boc-(R)-2-Amino-3-(3-Indolyl)-1-Propanol
- Boc-D-Trp-Ol
- N-Boc-D-Tryptophanol
- N-Alpha-T-Boc-D-Tryptophanol
- N-T-Boc-D-Tryptophanol
- N-alpha-t-Butyloxycarbonyl-D-tryptophanol
- tert-butyl [(1R)-2-hydroxy-1-(1H-indol-3-ylmethyl)ethyl]carbamate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
N(α)-Boc-D-tryptophanol, 98%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C16H22N2O3Purity:98%Color and Shape:Pale cream, PowderMolecular weight:290.36Carbamic acid, N-[(1R)-2-hydroxy-1-(1H-indol-3-ylmethyl)ethyl]-, 1,1-dimethylethyl ester
CAS:Formula:C16H22N2O3Purity:98%Color and Shape:SolidMolecular weight:290.3575



