CAS 158932-33-3: Secoisolariciresinol diglucoside
Description:Secoisolariciresinol diglucoside (SDG) is a lignan compound primarily found in flaxseed, but also present in other plant sources such as sesame seeds and whole grains. It is a glycoside, meaning it consists of a sugar moiety attached to a non-sugar component, in this case, secoisolariciresinol. SDG is known for its potential health benefits, including antioxidant properties and possible roles in reducing the risk of certain diseases, such as cardiovascular diseases and cancers. The compound is also studied for its ability to modulate estrogen metabolism, which may have implications for hormone-related conditions. In terms of physical characteristics, SDG is typically a white to off-white powder, soluble in water and organic solvents to varying degrees. Its stability can be influenced by factors such as temperature and pH. As a dietary component, it is often consumed through flaxseed oil or supplements, contributing to its growing interest in nutritional and medicinal research.
Formula:C32H46O16
InChI:InChI=1S/C32H46O16/c1-43-21-9-15(3-5-19(21)35)7-17(13-45-31-29(41)27(39)25(37)23(11-33)47-31)18(8-16-4-6-20(36)22(10-16)44-2)14-46-32-30(42)28(40)26(38)24(12-34)48-32/h3-6,9-10,17-18,23-42H,7-8,11-14H2,1-2H3/t17-,18-,23+,24+,25+,26+,27-,28-,29+,30+,31+,32+/m0/s1
InChI key:InChIKey=SBVBJPHMDABKJV-PGCJWIIOSA-N
SMILES:OC1=CC=C(C=C1OC)CC(COC2OC(CO)C(O)C(O)C2O)C(COC3OC(CO)C(O)C(O)C3O)CC4=CC=C(O)C(OC)=C4
- Synonyms:
- (2R,3R)-2,3-Bis[(4-hydroxy-3-methoxyphenyl)methyl]-1,4-butanediyl bis-β-<span class="text-smallcaps">D</span>-glucopyranoside
- (R,R)-Secoisolariciresinol diglucoside
- SDG
- Secoisolariciresinol diglucoside
- Secoisolariciresinol diglycoside
- Secoisolarisiresinol diglucoside
- β-<span class="text-smallcaps">D</span>-Glucopyranoside, (2R,3R)-2,3-bis[(4-hydroxy-3-methoxyphenyl)methyl]-1,4-butanediyl bis-
- β-<span class="text-smallcaps">D</span>-Glucopyranoside, 2,3-bis[(4-hydroxy-3-methoxyphenyl)methyl]-1,4-butanediyl bis-, [R-(R*,R*)]-
- β-D-Glucopyranoside, 2,3-bis[(4-hydroxy-3-methoxyphenyl)methyl]-1,4-butanediyl bis-, [R-(R*,R*)]-
- β-D-Glucopyranoside, (2R,3R)-2,3-bis[(4-hydroxy-3-methoxyphenyl)methyl]-1,4-butanediyl bis-
- See more synonyms
- (2R,3R)-2,3-Bis[(4-hydroxy-3-methoxyphenyl)methyl]-1,4-butanediyl bis-β-D-glucopyranoside
