CAS 15897-81-1
:2-Adamantanecarboxylic acid
Description:
2-Adamantanecarboxylic acid, with the CAS number 15897-81-1, is a bicyclic organic compound characterized by its adamantane structure, which consists of a fused cyclohexane framework. This compound features a carboxylic acid functional group (-COOH) attached to the second carbon of the adamantane ring. It is typically a white crystalline solid at room temperature and is known for its relatively high melting point compared to many other carboxylic acids, reflecting its rigid structure. The presence of the carboxylic acid group imparts acidic properties, allowing it to participate in various chemical reactions, such as esterification and amidation. Additionally, 2-adamantanecarboxylic acid exhibits moderate solubility in polar solvents, while being less soluble in nonpolar solvents due to its hydrophobic adamantane core. This compound has potential applications in organic synthesis and materials science, particularly in the development of polymers and pharmaceuticals, owing to its unique structural features and reactivity.
Formula:C11H15O2
InChI:InChI=1/C11H16O2/c12-11(13)10-8-2-6-1-7(4-8)5-9(10)3-6/h6-10H,1-5H2,(H,12,13)/p-1
SMILES:C1C2CC3CC1CC(C2)C3C(=O)[O-]
Synonyms:- 24. 2-Adamantanecarboxylic Acid
- Tricyclo[3.3.1.1~3,7~]Decane-2-Carboxylic Acid
- Tricyclo[3.3.1.1~3,7~]Decane-2-Carboxylate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Tricyclo[3.3.1.13,7]decane-2-carboxylic acid
CAS:Formula:C11H16O2Purity:97%Color and Shape:SolidMolecular weight:180.2435Adamantane-2-carboxylic acid
CAS:<p>Adamantane-2-carboxylic acid is a synthetic polymer that is used as a matrix in molecular electrostatic potential flow chromatography. Adamantane-2-carboxylic acid has been shown to form a polymeric matrix with trifluoromethyl groups and carbon tetrachloride, which can be used to separate neurotensin receptor agonists from dopamine antagonists. This compound also has the ability to cross the blood-brain barrier and bind to dopamine receptors, which may be useful for controlling diabetes. Adamantane-2-carboxylic acid is also an organic solvent and can be used as an alternative to chlorinated solvents such as carbon tetrachloride for environmental pollution control.</p>Formula:C11H16O2Purity:Min. 95%Color and Shape:White PowderMolecular weight:180.24 g/molAdamantane-2-carboxylic acid
CAS:Formula:C11H16O2Purity:97%Color and Shape:SolidMolecular weight:180.247



