CAS 15901-40-3
:N,N′,N′′-Tricyclohexyl-1-methylsilanetriamine
Description:
N,N′,N′′-Tricyclohexyl-1-methylsilanetriamine is an organosilicon compound characterized by its unique structure, which includes a silicon atom bonded to three cyclohexyl groups and an amine functional group. This compound is typically used in various applications, including as a curing agent in epoxy resins and as a catalyst in chemical reactions due to its ability to facilitate the formation of siloxane bonds. The presence of multiple cyclohexyl groups contributes to its hydrophobic properties, making it less soluble in water but more compatible with organic solvents. Additionally, the amine functionality can participate in chemical reactions, enhancing its utility in polymer chemistry and materials science. Its molecular structure allows for potential steric hindrance, which can influence reactivity and interaction with other chemical species. Safety data sheets should be consulted for handling and storage guidelines, as with any chemical substance, to ensure safe usage in laboratory or industrial settings.
Formula:C19H39N3Si
InChI:InChI=1S/C19H39N3Si/c1-23(20-17-11-5-2-6-12-17,21-18-13-7-3-8-14-18)22-19-15-9-4-10-16-19/h17-22H,2-16H2,1H3
InChI key:InChIKey=HDNXAGOHLKHJOA-UHFFFAOYSA-N
SMILES:[Si](NC1CCCCC1)(NC2CCCCC2)(NC3CCCCC3)C
Synonyms:- Methyltris(cyclohexylamino)silane
- N,N',N''-tricyclohexyl-1-methylsilanetriamine
- Silanetriamine, N,N′,N′′-tricyclohexyl-1-methyl-
- Triscyclohexylaminomethylsilane
- Tris(cyclohexylamino)methylsilane
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
