CAS 159015-07-3

4-Methyl-2-oxazolecarboxaldehyde

Description:

4-Methyl-2-oxazolecarboxaldehyde is an organic compound characterized by its oxazole ring, which is a five-membered heterocyclic structure containing both nitrogen and oxygen. This compound features a methyl group and an aldehyde functional group, contributing to its reactivity and potential applications in organic synthesis. It is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. The presence of the aldehyde group makes it susceptible to oxidation and nucleophilic attack, which can be exploited in various chemical reactions, including condensation and addition reactions. Additionally, the oxazole moiety can participate in further chemical transformations, making this compound of interest in medicinal chemistry and material science. Its unique structure may also impart specific biological activities, although detailed studies on its pharmacological properties may be limited. As with many organic compounds, proper handling and storage are essential due to potential reactivity and safety considerations.

Formula: C₅H₅NO₂

InChI: InChI=1S/C5H5NO2/c1-4-3-8-5(2-7)6-4/h2-3H,1H3

InChI key: InChIKey=WQFUYXRLSRTPKS-UHFFFAOYSA-N

SMILES: C(=O)C1=NC(C)=CO1

Synonyms:

• 4-Methyl-2-oxazolecarboxaldehyde
• 2-Oxazolecarboxaldehyde, 4-methyl-

2-Oxazolecarboxaldehyde, 4-Methyl-

CAS: 159015-07-3

Formula: C₅H₅NO₂

Molecular weight: 111.0987

Ref: IN-DA001QF6

4-Methyloxazole-2-carbaldehyde

CAS: 159015-07-3

Formula: C₅H₅NO₂

Purity: 95.0%

Molecular weight: 111.1

Ref: 10-F464761