CAS 159016-24-7

1,1-Dimethylethyl 2-[2-(4-chlorophenyl)-1-iminoethyl]hydrazinecarboxylate

Description:

1,1-Dimethylethyl 2-[2-(4-chlorophenyl)-1-iminoethyl]hydrazinecarboxylate, with the CAS number 159016-24-7, is a chemical compound characterized by its complex structure, which includes a hydrazinecarboxylate moiety and a substituted phenyl group. This compound typically exhibits properties associated with both hydrazine derivatives and carboxylates, such as potential reactivity due to the presence of the hydrazine functional group, which can participate in various chemical reactions, including condensation and oxidation. The presence of the 4-chlorophenyl substituent may influence its biological activity and solubility, potentially enhancing its lipophilicity. Additionally, the dimethyl substituents contribute to steric hindrance, which can affect the compound's reactivity and interaction with biological targets. Overall, this compound may be of interest in medicinal chemistry and agrochemical applications, although specific biological activities and safety profiles would require further investigation through empirical studies.

Formula: C₁₃H₁₈ClN₃O₂

InChI: InChI=1S/C13H18ClN3O2/c1-13(2,3)19-12(18)17-16-11(15)8-9-4-6-10(14)7-5-9/h4-7H,8H2,1-3H3,(H2,15,16)(H,17,18)

InChI key: InChIKey=LNCQFLSZOPKRQA-UHFFFAOYSA-N

SMILES: C(C(NNC(OC(C)(C)C)=O)=N)C1=CC=C(Cl)C=C1

Synonyms:

• 1,1-Dimethylethyl 2-[2-(4-chlorophenyl)-1-iminoethyl]hydrazinecarboxylate
• NSC 684068
• Hydrazinecarboxylic acid, 2-[2-(4-chlorophenyl)-1-iminoethyl]-, 1,1-dimethylethyl ester

N'-[1-Amino-2-(4-chlorophenyl)ethylidene]hydrazinecarboxylic acid tert-butyl ester

CAS: 159016-24-7

N'-[1-Amino-2-(4-chlorophenyl)ethylidene]hydrazinecarboxylic acid tert-butyl ester

Purity: 95%

Molecular weight: 283.75g/mol

Ref: 54-OR346004