CAS 15903-66-9
:3-Methylisothiazole-4-carboxylic acid
Description:
3-Methylisothiazole-4-carboxylic acid is a heterocyclic organic compound characterized by its isothiazole ring structure, which includes a sulfur and nitrogen atom. This compound features a methyl group at the 3-position and a carboxylic acid functional group at the 4-position, contributing to its reactivity and potential applications. It is typically a colorless to pale yellow solid, soluble in polar solvents due to the presence of the carboxylic acid group. The compound is known for its antimicrobial properties, making it of interest in various fields, including agriculture and pharmaceuticals. Its molecular structure allows for interactions with biological systems, which can lead to inhibition of certain enzymes or microbial growth. As with many isothiazole derivatives, it may exhibit a range of biological activities, including antifungal and antibacterial effects. Safety data should be consulted for handling and usage, as the compound may pose health risks if not managed properly.
Formula:C5H5NO2S
InChI:InChI=1/C5H5NO2S/c1-3-4(5(7)8)2-9-6-3/h2H,1H3,(H,7,8)
SMILES:Cc1c(csn1)C(=O)O
Synonyms:- 3-Methyl-1,2-Thiazole-4-Carboxylic Acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
3-Methylisothiazole-4-carboxylic acid
CAS:Formula:C5H5NO2SPurity:95%Color and Shape:SolidMolecular weight:143.16373-Methylisothiazole-4-carboxylic acid
CAS:3-Methylisothiazole-4-carboxylic acidPurity:95%Color and Shape:SolidMolecular weight:143.16g/mol3-Methylisothiazole-4-carboxylic acid
CAS:Formula:C5H5NO2SPurity:95%Color and Shape:SolidMolecular weight:143.163-Methylisothiazole-4-carboxylic acid
CAS:<p>3-Methylisothiazole-4-carboxylic acid is an amino acid that has shown anti-tumor activity. It has been shown to inhibit the growth of leukemia cells in mice and to prevent the proliferation of human cancer cells in vitro. 3-Methylisothiazole-4-carboxylic acid is a competitive inhibitor of benzoylamino, which is a key enzyme involved in the synthesis of DNA. The compound inhibits DNA replication by binding to nucleic acids at the site where they are synthesized, blocking the formation of base pairs. This drug also has immunosuppressive properties and can be used as an adjuvant therapy for hypersensitivity reactions such as asthma and allergies.</p>Formula:C5H5NO2SPurity:Min. 95%Molecular weight:143.16 g/mol



