CAS 159091-35-7
:5-SULFOOXYMETHYLFURFURAL
Description:
5-SulfOoxymethylfurfural (CAS 159091-35-7) is a chemical compound derived from furfural, which is a platform chemical obtained from biomass. This compound features a furan ring substituted with a sulfonic acid group and a hydroxymethyl group, contributing to its unique properties. It is typically characterized by its solubility in water due to the presence of the sulfonic acid group, which enhances its polarity. 5-SulfOoxymethylfurfural is of interest in various fields, including organic synthesis and materials science, due to its potential as a building block for more complex molecules. Its functional groups allow for various chemical reactions, making it a versatile intermediate in the synthesis of pharmaceuticals, agrochemicals, and other fine chemicals. Additionally, its bio-based origin aligns with the growing interest in sustainable chemistry and the development of renewable resources. Overall, 5-SulfOoxymethylfurfural represents a valuable compound in the context of green chemistry and the utilization of biomass-derived feedstocks.
Formula:C6H6O6S
InChI:InChI=1/C6H6O6S/c7-3-5-1-2-6(12-5)4-11-13(8,9)10/h1-3H,4H2,(H,8,9,10)
SMILES:c1cc(COS(=O)(=O)O)oc1C=O
Synonyms:- 5-((Sulphooxy)Methyl)Furfural
- (5-Formylfuran-2-Yl)Methyl Hydrogen Sulfate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
