CAS 15911-30-5
:4-Methyl-2-(4-nitrophenyl)-5-thiazolecarboxylic acid
Description:
4-Methyl-2-(4-nitrophenyl)-5-thiazolecarboxylic acid, with the CAS number 15911-30-5, is a chemical compound characterized by its thiazole ring, which is a five-membered heterocyclic structure containing sulfur and nitrogen. This compound features a methyl group and a nitrophenyl substituent, contributing to its unique chemical properties. It is typically a solid at room temperature and exhibits moderate solubility in organic solvents, while its solubility in water may vary. The presence of the carboxylic acid functional group indicates that it can participate in acid-base reactions, making it a potential candidate for various chemical syntheses and applications. Additionally, the nitro group can influence the compound's reactivity and polarity, affecting its interactions in biological systems. This compound may be of interest in pharmaceutical research, agrochemicals, or materials science due to its structural features and potential biological activity. As with many organic compounds, safety precautions should be observed when handling it, as it may pose health risks or environmental hazards.
Formula:C11H8N2O4S
InChI:InChI=1S/C11H8N2O4S/c1-6-9(11(14)15)18-10(12-6)7-2-4-8(5-3-7)13(16)17/h2-5H,1H3,(H,14,15)
InChI key:InChIKey=IAWXKDQKIJAATO-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1SC(=NC1C)C2=CC=C(N(=O)=O)C=C2
Synonyms:- 4-Methyl-2-(4-nitrophenyl)-5-thiazolecarboxylic acid
- 5-Thiazolecarboxylic acid, 4-methyl-2-(4-nitrophenyl)-
- 5-Thiazolecarboxylic acid, 4-methyl-2-(p-nitrophenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
