CAS 15911-87-2
:stizolobic acid
Description:
Stizolobic acid, with the CAS number 15911-87-2, is a naturally occurring compound classified as a phenolic acid. It is primarily derived from certain plant sources and is known for its potential biological activities. The structure of stizolobic acid features a hydroxyl group and a carboxylic acid group, which contribute to its acidic properties and reactivity. This compound has garnered interest in the field of medicinal chemistry due to its reported antioxidant, anti-inflammatory, and antimicrobial properties. Stizolobic acid may also play a role in various biochemical pathways, making it a subject of research for its potential therapeutic applications. Additionally, its solubility characteristics can vary depending on the solvent, which is important for its extraction and utilization in various formulations. Overall, stizolobic acid represents a significant compound in phytochemistry and pharmacognosy, with ongoing studies aimed at elucidating its full range of biological effects and potential uses in health and medicine.
Formula:C9H9NO6
InChI:InChI=1/C9H9NO6/c10-5(8(12)13)1-4-2-6(9(14)15)16-7(11)3-4/h2-3,5H,1,10H2,(H,12,13)(H,14,15)/t5-/m0/s1
InChI key:InChIKey=KQZBVNZAEQASKU-YFKPBYRVSA-N
SMILES:C([C@@H](C(O)=O)N)C=1C=C(C(O)=O)OC(=O)C1
Synonyms:- (αS)-α-Amino-6-carboxy-2-oxo-2H-pyran-4-propanoic acid
- 2H-Pyran-4-propanoic acid, alpha-amino-6-carboxy-2-oxo-, (S)-
- 2H-Pyran-4-propanoic acid, α-amino-6-carboxy-2-oxo-, (S)-
- 2H-Pyran-4-propanoic acid, α-amino-6-carboxy-2-oxo-, (αS)-
- 4-[(2S)-2-amino-2-carboxyethyl]-2-oxo-2H-pyran-6-carboxylic acid
- <span class="text-smallcaps">L</span>-Stizolobic acid
- alpha-Amino-6-carboxy-2-oxo-2H-pyran-4-propionic acid
- L-Stizolobic acid
- Stizolobic acid
- (S)-α-Amino-6-carboxy-2-oxo-2H-pyran-4-propanoic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
