CAS 159138-80-4: Cariporide
Description:Cariporide, with the CAS number 159138-80-4, is a chemical compound classified as a selective inhibitor of the sodium-hydrogen exchanger (NHE-1). It is primarily studied for its potential cardioprotective effects, particularly in the context of ischemia-reperfusion injury. Cariporide exhibits a high affinity for the NHE-1 isoform, which plays a crucial role in regulating intracellular pH and sodium levels in cardiac cells. By inhibiting this exchanger, Cariporide can help reduce cellular damage during periods of low oxygen supply, thereby preserving cardiac function. The compound is typically characterized by its specific molecular structure, which includes a pyridine ring and various functional groups that contribute to its biological activity. In terms of solubility, Cariporide is generally soluble in organic solvents, which facilitates its use in laboratory settings. Its pharmacological profile suggests potential applications in treating conditions such as myocardial infarction and heart failure, although further research is necessary to fully understand its therapeutic potential and safety profile.
Formula:C12H17N3O3S
InChI:InChI=1S/C12H17N3O3S/c1-7(2)9-5-4-8(11(16)15-12(13)14)6-10(9)19(3,17)18/h4-7H,1-3H3,(H4,13,14,15,16)
InChI key:InChIKey=IWXNYAIICFKCTM-UHFFFAOYSA-N
SMILES:O=C(NC(=N)N)C1=CC=C(C(=C1)S(=O)(=O)C)C(C)C
- Synonyms:
- 4-Isopropyl-3-(Methylsulfonyl)Benzoyl-Guanidine Methanesulfonate
- Benzamide, N-(aminoiminomethyl)-4-(1-methylethyl)-3-(methylsulfonyl)-
- Cariporide [INN]
- Hoe 642
- Hoe642
- N-(Aminoiminomethyl)-4-(1-methylethyl)-3-(methylsulfonyl)benzamide
- N-(Diaminomethylene)-4-isopropyl-3-(methylsulfonyl)benzamide
- N-(diaminomethylidene)-3-(methylsulfonyl)-4-(propan-2-yl)benzamide
- Unii-7E3392891K
- Cariporide
- See more synonyms
