CymitQuimica logo

CAS 15917-50-7

:

2-{4-[(1Z)-1,2-diphenylprop-1-en-1-yl]phenoxy}-N,N-dimethylethanamine

Description:
The chemical substance known as 2-{4-[(1Z)-1,2-diphenylprop-1-en-1-yl]phenoxy}-N,N-dimethylethanamine, with the CAS number 15917-50-7, is a complex organic compound characterized by its unique structural features. It contains a phenoxy group, which is a phenyl ether, linked to a dimethylamino group, indicating potential basic properties. The presence of the diphenylpropene moiety suggests that it may exhibit significant hydrophobic characteristics and could participate in π-π stacking interactions due to the aromatic rings. This compound may also display biological activity, potentially acting as a ligand or modulator in various biochemical pathways. Its structural complexity implies that it could be of interest in medicinal chemistry, particularly in the development of pharmaceuticals. Additionally, the presence of multiple functional groups may influence its solubility, reactivity, and interaction with biological targets. Overall, this compound exemplifies the intricate relationship between molecular structure and chemical properties, which is crucial for its potential applications in research and industry.
Formula:C25H27NO
InChI:InChI=1/C25H27NO/c1-20(21-10-6-4-7-11-21)25(22-12-8-5-9-13-22)23-14-16-24(17-15-23)27-19-18-26(2)3/h4-17H,18-19H2,1-3H3/b25-20-
SMILES:C/C(=C(\c1ccccc1)/c1ccc(cc1)OCCN(C)C)/c1ccccc1
Synonyms:
  • (Z)-2-(4-(1,2-Diphenyl-1-propenyl)phenoxy)-N,N-dimethylethanamine
  • Ethanamine, 2-(4-(1,2-diphenyl-1-propenyl)phenoxy)-N,N-dimethyl-, (Z)-
  • ethanamine, 2-[4-[(1Z)-1,2-diphenyl-1-propen-1-yl]phenoxy]-N,N-dimethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.