CAS 159191-56-7
:4-(TERT-BUTYLDIMETHYLSILYLOXY)PHENYLBORONIC ACID
Description:
4-(Tert-butyldimethylsilyloxy)phenylboronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a phenyl ring that is further substituted with a tert-butyldimethylsilyloxy group. This compound typically exhibits properties such as good solubility in organic solvents, which is advantageous for various synthetic applications. The boronic acid moiety allows for participation in Suzuki coupling reactions, making it valuable in organic synthesis, particularly in the formation of carbon-carbon bonds. The tert-butyldimethylsilyloxy group serves as a protecting group, enhancing the stability of the compound under certain conditions and facilitating further functionalization. Additionally, the presence of the silyl group can influence the reactivity and selectivity of the compound in chemical reactions. Overall, this compound is significant in the field of medicinal chemistry and materials science, where it can be utilized in the development of pharmaceuticals and advanced materials.
Formula:C12H21BO3Si
InChI:InChI=1/C12H21BO3Si/c1-12(2,3)17(4,5)16-11-8-6-10(7-9-11)13(14)15/h6-9,14-15H,1-5H3
SMILES:CC(C)(C)[Si](C)(C)Oc1ccc(cc1)B(O)O
Synonyms:- 4-(T-Butyl Dimethylsiloxy) Phenyl Boronic Acid
- 4-(Tert-Butyl Dimethylsiloxy)Phenyl Boronic Acid
- 4-(Tert-Butyldimethylsilyoxy)Phenylboronic Acid
- Akos Brn-0412
- 4-(Tert-Butyldimethylsilyoxy)Phenylboron
- 4-(tert-Butyldimethylsilyloxy)benzeneboronic acid
- (4-{[Tert-Butyl(Dimethyl)Silyl]Oxy}Phenyl)Boronic Acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
4-(tert-Butyldimethylsilyloxy)phenylboronic Acid (contains varying amounts of Anhydride)
CAS:Formula:C12H21BO3SiPurity:97.0 to 108.0 %Color and Shape:White to Almost white powder to crystalMolecular weight:252.194-(tert-Butyldimethylsilyloxy)phenylboronic acid
CAS:Formula:C12H21BO3SiPurity:97%Color and Shape:SolidMolecular weight:252.18984-(tert-Butyldimethylsilyloxy)benzeneboronic acid
CAS:4-(tert-Butyldimethylsilyloxy)benzeneboronic acidFormula:C12H21BO3SiPurity:99%Color and Shape: pink solidMolecular weight:252.18983g/mol4-(tert-Butyldimethylsilyloxy)phenylboronic acid
CAS:<p>4-(tert-Butyldimethylsilyloxy)phenylboronic acid (BSPOH) is a molecule that has been shown to have growth factor activity. Studies have shown that BSPOH can stimulate the uptake of iron in cells, which may be due to its ability to increase hepcidin production. This compound also has anti-cancer properties and can induce apoptosis in cancer cell lines.</p>Formula:C12H21BO3SiPurity:Min. 95%Color and Shape:White PowderMolecular weight:252.19 g/mol4-(tert-Butyldimethylsiloxy)phenyl boronic acid
CAS:Formula:C12H21BO3SiPurity:95%Color and Shape:SolidMolecular weight:252.19




