CAS 1592-43-4
:Trimethylindolinonaphthopyrylospiran; 98%
Description:
Trimethylindolinonaphthopyrylospiran, with the CAS number 1592-43-4, is a synthetic organic compound known for its unique structural features and photochemical properties. This substance belongs to the class of spiro compounds, which are characterized by a spirocyclic structure where two rings are connected through a single atom. It exhibits notable chromogenic behavior, meaning it can change color in response to environmental stimuli, making it useful in various applications such as sensors and indicators. The compound is typically stable under standard conditions but may undergo photochemical reactions when exposed to light, leading to potential applications in photonics and materials science. Its high purity level of 98% indicates that it is suitable for research and industrial applications where precision is crucial. Additionally, like many organic compounds, it should be handled with care, following appropriate safety protocols to mitigate any risks associated with its use. Overall, Trimethylindolinonaphthopyrylospiran is a compound of interest in both academic and industrial chemistry due to its distinctive properties and potential applications.
Formula:C23H21NO
InChI:InChI=1/C23H21NO/c1-22(2)19-10-6-7-11-20(19)24(3)23(22)15-14-18-17-9-5-4-8-16(17)12-13-21(18)25-23/h4-15H,1-3H3
SMILES:CC1(C)c2ccccc2N(C)C21C=Cc1c3ccccc3ccc1O2
Synonyms:- 1,3,3-Trimethylindolino-beta-naphthopyrylospiran
- 1',3',3'-Trimethyl-1',3'-Dihydrospiro[Benzo[F]Chromene-3,2'-Indole]
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
1,3,3-Trimethylindolino-β-naphthopyrylospiran
CAS:Formula:C23H21NOPurity:>98.0%(T)Color and Shape:White to Almost white powder to crystalMolecular weight:327.431,3,3-Trimethylindolino-β-naphthopyrylospiran
CAS:Formula:C23H21NOPurity:98%Color and Shape:SolidMolecular weight:327.41891',3',3'-Trimethylspiro[benzo[f]chromene-3,2'-indoline]
CAS:1',3',3'-Trimethylspiro[benzo[f]chromene-3,2'-indoline]Purity:98%Molecular weight:327.43g/mol1,3,3-Trimethylindolino-b-naphthopyrylospiran [Photochromic Compound]
CAS:<p>1,3,3-Trimethylindolino-b-naphthopyrylospiran is a photochromic compound that is soluble in ethanol solutions. It's hydrophobic and binds to the cavity of a surface method. When the environment changes, such as temperature or light exposure, the molecule undergoes a change in its optical properties. The interaction between 1,3,3-trimethylindolino-b-naphthopyrylospiran and β-cyclodextrin enhances its photochromism. This compound has been shown to decolorize and can be used in materials that are sensitive to UV light.</p>Purity:Min. 95%Color and Shape:White To Light (Or Pale) Yellow Red SolidMolecular weight:327.42




