CymitQuimica logo

CAS 1592-62-7

:

2,3,4,9-TETRAHYDRO-1H-CARBAZOL-1-OL

Description:
2,3,4,9-Tetrahydro-1H-carbazol-1-ol, with the CAS number 1592-62-7, is a bicyclic organic compound that belongs to the carbazole family. This substance features a fused ring system, which includes a carbazole moiety and a hydroxyl group, contributing to its unique chemical properties. It is typically characterized by its solid state at room temperature and exhibits moderate solubility in organic solvents. The presence of the hydroxyl group imparts polar characteristics, influencing its reactivity and potential interactions with other chemical species. This compound is of interest in various fields, including medicinal chemistry, due to its potential biological activities, such as antioxidant and anti-inflammatory properties. Additionally, its structural features may allow for further derivatization, making it a valuable precursor in synthetic organic chemistry. Safety data indicates that, like many organic compounds, it should be handled with care, as it may pose health risks if ingested or inhaled. Overall, 2,3,4,9-tetrahydro-1H-carbazol-1-ol is a compound with intriguing chemical characteristics and potential applications.
Formula:C12H13NO
InChI:InChI=1S/C12H13NO/c14-11-7-3-5-9-8-4-1-2-6-10(8)13-12(9)11/h1-2,4,6,11,13-14H,3,5,7H2
InChI key:GXUZLXNKCOCTLH-UHFFFAOYSA-N
SMILES:C1CC(C2=C(C1)C3=CC=CC=C3N2)O
Found 5 products.