CAS 15920-89-5
:na-carbamyl-L-arginine
Description:
N-carbamyl-L-arginine, with the CAS number 15920-89-5, is a derivative of the amino acid L-arginine, characterized by the presence of a carbamyl group attached to the nitrogen atom of the guanidino group. This compound is typically a white to off-white crystalline powder, soluble in water due to its polar nature, which is attributed to the amino and carbamyl functional groups. N-carbamyl-L-arginine is known for its potential biological activities, including its role in nitric oxide synthesis, which is crucial for various physiological processes such as vasodilation and immune response. It may also exhibit antioxidant properties. The compound is of interest in biochemical research and potential therapeutic applications, particularly in cardiovascular health and metabolic disorders. As with many amino acid derivatives, its stability and reactivity can be influenced by pH and temperature, making it important to consider these factors in experimental settings.
Formula:C7H15N5O3
InChI:InChI=1/C7H15N5O3/c8-6(9)11-3-1-2-4(5(13)14)12-7(10)15/h4H,1-3H2,(H,13,14)(H4,8,9,11)(H3,10,12,15)
SMILES:C(CC(C(=O)O)NC(=N)O)CNC(=N)N
Synonyms:- N~2~-carbamoyl-N~5~-(diaminomethylidene)ornithine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
(2S)-5-carbamimidamido-2-(carbamoylamino)pentanoic acid
CAS:Formula:C7H15N5O3Molecular weight:217.2257


