
CAS 159276-59-2
:1-(2-Bromo-1-methylethenyl)-2,4-difluorobenzene
Description:
1-(2-Bromo-1-methylethenyl)-2,4-difluorobenzene, with the CAS number 159276-59-2, is an organic compound characterized by its unique molecular structure, which includes a brominated vinyl group and a difluorobenzene moiety. This compound features a bromine atom attached to a carbon that is part of a vinyl group, which contributes to its reactivity and potential applications in organic synthesis. The presence of two fluorine atoms on the benzene ring enhances its electron-withdrawing properties, influencing its chemical behavior and interactions. Typically, compounds like this may exhibit properties such as moderate volatility and solubility in organic solvents, making them suitable for various chemical reactions, including nucleophilic substitutions and coupling reactions. Additionally, the presence of halogens can impart unique characteristics, such as increased lipophilicity and potential biological activity. As with many halogenated compounds, safety precautions should be taken due to potential toxicity and environmental concerns associated with their use and disposal.
Formula:C9H7BrF2
InChI:InChI=1S/C9H7BrF2/c1-6(5-10)8-3-2-7(11)4-9(8)12/h2-5H,1H3
InChI key:InChIKey=PARMEFSOYLFNDK-UHFFFAOYSA-N
SMILES:C(=CBr)(C)C1=C(F)C=C(F)C=C1
Synonyms:- 1-(2-Bromo-1-methylethenyl)-2,4-difluorobenzene
- Benzene, 1-(2-bromo-1-methylethenyl)-2,4-difluoro-
- 1-(2-Bromo-1-methylvinyl)-2,4-difluorobenzene
- Posaconazole Impurity 64
- Posaconazole Impurity 57 Q: What is the CAS Number of
- Posaconazole Impurity 57Q: What is
- Posaconazole Impurity 57
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
