CAS 159299-93-1
:4-Oxo-1,3-piperidinedicarboxylic acid 1-benzyl ester 3-methyl ester
Description:
4-Oxo-1,3-piperidinedicarboxylic acid 1-benzyl ester 3-methyl ester, with the CAS number 159299-93-1, is a chemical compound characterized by its piperidine ring structure, which features two carboxylic acid groups and an ester functional group. This compound typically exhibits properties associated with both amines and carboxylic acids, including potential solubility in polar solvents due to the presence of the carboxylic acid moieties. The benzyl ester and methyl ester groups contribute to its lipophilicity, which can influence its biological activity and interaction with other molecules. The presence of the carbonyl group (4-oxo) suggests potential reactivity in various chemical reactions, such as nucleophilic additions. This compound may be of interest in medicinal chemistry and organic synthesis, particularly in the development of pharmaceuticals or as intermediates in chemical reactions. Its specific applications and behavior would depend on the context of use, including the conditions of synthesis and the presence of other reactants or solvents.
Formula:C15H17NO5
InChI:InChI=1/C15H17NO5/c1-20-14(18)12-9-16(8-7-13(12)17)15(19)21-10-11-5-3-2-4-6-11/h2-6,12H,7-10H2,1H3
SMILES:COC(=O)C1CN(CCC1=O)C(=O)OCc1ccccc1
Synonyms:- O1-benzyl O3-methyl 4-oxopiperidine-1,3-dicarboxylate
- (140176-27-8) 4-oxo-1,3-piperidinedicarboxylic acid 3-methyl 1-(phenylmethyl) ester
- N-CBZ-3-carbomethoxy-4-piperidone
- 4-Oxo-1,3-piperidinedicarboxylic acid 3-methyl 1-(phenylmethyl) ester
- Methyl 1-benzyloxycarbonyl-4-oxo-3-piperidinecarboxylate
- 1-Benzyl 3-methyl 4-oxopiperidine-1,3-dicarboxylate
- 1-O-benzyl 3-O-methyl 4-oxopiperidine-1,3-dicarboxylate
- 1,3-Piperidinedicarboxylic acid, 4-oxo-, 3-methyl 1-(phenylmethyl) ester
- 4-Oxo-1,3-piperidinedicarboxylic acid 1-benzyl ester 3-methyl ester
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
1,3-Piperidinedicarboxylic acid, 4-oxo-, 3-methyl 1-(phenylmethyl) ester
CAS:Formula:C15H17NO5Purity:98%Color and Shape:SolidMolecular weight:291.29921,3-Piperidinedicarboxylic acid, 4-oxo-, 3-methyl 1-(phenylmethyl) ester
CAS:1,3-Piperidinedicarboxylic acid, 4-oxo-, 3-methyl 1-(phenylmethyl) esterPurity:98%Molecular weight:291.3g/mol4-OXO-1,3-PIPERIDINEDICARBOXYLIC ACID 1-BENZYL ESTER 3-METHYL ESTER
CAS:Formula:C15H17NO5Purity:98%Color and Shape:SolidMolecular weight:291.303


