CymitQuimica logo

CAS 159305-16-5

:

6-Fluoro-3-methyl-1H-indazole

Description:
6-Fluoro-3-methyl-1H-indazole is a chemical compound characterized by its indazole core, which is a bicyclic structure containing a five-membered ring fused to a six-membered ring. The presence of a fluorine atom at the 6-position and a methyl group at the 3-position contributes to its unique chemical properties. This compound is typically a solid at room temperature and is known for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its biological activity. It may exhibit various interactions with biological targets, making it of interest in drug discovery. The molecular structure allows for specific reactivity patterns, and its fluorine substitution can enhance lipophilicity, potentially influencing its pharmacokinetic properties. As with many indazole derivatives, it may also display interesting electronic properties due to the conjugated system within the indazole framework. Safety and handling precautions should be observed, as with any chemical substance, particularly in laboratory settings.
Formula:C8H7FN2
InChI:InChI=1S/C8H7FN2/c1-5-7-3-2-6(9)4-8(7)11-10-5/h2-4H,1H3,(H,10,11)
InChI key:InChIKey=JTHZUSWLNCPZLX-UHFFFAOYSA-N
SMILES:CC=1C=2C(NN1)=CC(F)=CC2
Synonyms:
  • 1H-Indazole, 6-fluoro-3-methyl-
  • 6-fluoro-3-methyl-1H-indazole
Found 5 products.