CAS 15931-19-8

2-methylpyridine-3,4-diamine

Description:

2-Methylpyridine-3,4-diamine, also known by its CAS number 15931-19-8, is an organic compound characterized by a pyridine ring substituted with two amino groups at the 3 and 4 positions and a methyl group at the 2 position. This compound is a derivative of pyridine, which is a six-membered aromatic ring containing one nitrogen atom. The presence of amino groups contributes to its basicity and potential reactivity, making it useful in various chemical reactions, including those involving nucleophilic substitution. The methyl group enhances its solubility in organic solvents and may influence its biological activity. 2-Methylpyridine-3,4-diamine can participate in the formation of coordination complexes and may serve as a ligand in coordination chemistry. Its structural features suggest potential applications in pharmaceuticals, agrochemicals, and materials science. However, safety and handling precautions should be observed, as with many amine-containing compounds, due to potential toxicity and reactivity.

Formula: C₆H₉N₃

InChI: InChI=1/C6H9N3/c1-4-6(8)5(7)2-3-9-4/h2-3H,8H2,1H3,(H2,7,9)

SMILES: Cc1c(c(=N)cc[nH]1)N

Synonyms:

• 3,4-Pyridinediamine, 2-Methyl-
• 2-Methylpyridine-3,4-diamine

3,4-Pyridinediamine, 2-methyl-

CAS: 15931-19-8

Formula: C₆H₉N₃

Purity: 95%

Color and Shape: Solid

Molecular weight: 123.1558

Ref: IN-DA001QM4

3,4-Diamino-2-methylpyridine

CAS: 15931-19-8

3,4-Diamino-2-methylpyridine

Purity: 95%

Molecular weight: 123.16g/mol

Ref: 54-OR345507

2-Methylpyridine-3,4-diamine

CAS: 15931-19-8

Formula: C₆H₉N₃

Purity: 95%

Color and Shape: Solid, Brown powder

Molecular weight: 123.159

Ref: 10-F219246