CAS 15932-71-5

2H-Pyrido[1,2-a]pyrazin-1(6H)-one,hexahydro-(6CI,8CI,9CI)

Description:

2H-Pyrido[1,2-a]pyrazin-1(6H)-one, hexahydro- (CAS 15932-71-5) is a heterocyclic organic compound characterized by its fused pyridine and pyrazine rings. This compound features a saturated hexahydro structure, which contributes to its stability and unique chemical properties. It typically exhibits a pale yellow to off-white appearance and is soluble in polar organic solvents. The presence of nitrogen atoms in its ring structure can influence its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and cyclization processes. Its derivatives may possess biological activity, which has led to interest in its potential applications in pharmaceuticals and agrochemicals. The compound's molecular structure allows for various functionalization possibilities, enhancing its utility in synthetic chemistry. As with many nitrogen-containing heterocycles, it may also exhibit interesting electronic properties, making it a subject of study in materials science and organic electronics. Safety data should be consulted for handling and usage, as with any chemical substance.

Formula: C₈H₁₄N₂O

InChI: InChI=1/C8H14N2O/c11-8-7-3-1-2-5-10(7)6-4-9-8/h7H,1-6H2,(H,9,11)

SMILES: C1CCN2CCN=C(C2C1)O

Synonyms:

• 2H-Pyrido(1,2-a)pyrazin-1(6H)-one, hexahydro-
• 1,4-Diazabicyclo(4.4.0)decane-5-one
• Hexahydro-2H-pyrido(1,2-a)pyrazin-1(6H)-one

Hexahydro-pyrido[1,2-a]pyrazin-1-one

CAS: 15932-71-5

Formula: C₈H₁₄N₂O

Color and Shape: Solid

Molecular weight: 154.213

Ref: 10-F026340