CAS 159326-75-7

Pyrrolo[2,1-f][1,2,4]triazin-4(1H)-one, 2-amino- (9CI)

Description:

Pyrrolo[2,1-f][1,2,4]triazin-4(1H)-one, 2-amino- (9CI) is a heterocyclic organic compound characterized by its unique triazine and pyrrole ring structure. This compound features a triazine core fused with a pyrrole ring, which contributes to its potential biological activity. The presence of an amino group enhances its reactivity and solubility in polar solvents. It is often studied for its pharmacological properties, including potential applications in medicinal chemistry due to its ability to interact with biological targets. The compound may exhibit various properties such as moderate stability under standard conditions, and it can participate in diverse chemical reactions, including nucleophilic substitutions and cycloadditions. Its molecular structure allows for potential interactions with enzymes or receptors, making it a subject of interest in drug discovery and development. Safety data and handling precautions should be considered, as with any chemical substance, to ensure proper laboratory practices.

Formula: C₆H₆N₄O

InChI: InChI=1/C6H6N4O/c7-6-8-5(11)4-2-1-3-10(4)9-6/h1-3H,(H3,7,8,9,11)

SMILES: c1cc2c(=O)[nH]c(=N)[nH]n2c1

Synonyms:

• 2-Aminopyrrolo[2,1-f][1,2,4]triazin-4(1H)-one
• pyrrolo[2,1-f][1,2,4]triazin-4(1H)-one, 2-amino-

Pyrrolo[2,1-f][1,2,4]triazin-4(1H)-one, 2-amino- (9CI)

CAS: 159326-75-7

Formula: C₆H₆N₄O

Purity: 95%

Color and Shape: Solid

Molecular weight: 150.1380

Ref: IN-DA003GK3