CAS 15936-09-1

1,8-NAPHTHYRIDIN-2(8H)-ONE

Description:

1,8-Naphthyridin-2(8H)-one, with the CAS number 15936-09-1, is a heterocyclic organic compound characterized by a fused ring system that includes a naphthyridine structure. This compound features a nitrogen atom in the ring, contributing to its basicity and potential reactivity. It typically appears as a crystalline solid and is soluble in polar organic solvents. The presence of the carbonyl group (C=O) in the structure enhances its reactivity, making it a candidate for various chemical transformations. 1,8-Naphthyridin-2(8H)-one is of interest in medicinal chemistry due to its potential biological activities, including antimicrobial and antitumor properties. Its derivatives may exhibit enhanced pharmacological effects, making it a subject of research in drug development. Additionally, the compound can participate in coordination chemistry, forming complexes with metal ions, which can be useful in catalysis and materials science. Overall, 1,8-naphthyridin-2(8H)-one is a versatile compound with significant implications in both synthetic and medicinal chemistry.

Formula: C₈H₆N₂O

InChI: InChI=1/C8H6N2O/c11-7-4-3-6-2-1-5-9-8(6)10-7/h1-5H,(H,9,10,11)

SMILES: c1cc2ccc(nc2nc1)O

Synonyms:

• 1,8-naphthyridin-2(1H)-one
• 1,2-Dihydro-1,8-Naphthyridin-2-One

1,8-NAPHTHYRIDIN-2(1H)-ONE

CAS: 15936-09-1

Formula: C₈H₆N₂O

Purity: 98%

Color and Shape: Solid

Molecular weight: 146.1460

Ref: IN-DA001QMX

1,8-Naphthyridin-2(1H)-one

CAS: 15936-09-1

1,8-Naphthyridin-2(1H)-one

Purity: 98%

Molecular weight: 146.149g/mol

Ref: 54-OR72975

1,8-Naphthyridin-2(1H)-one

CAS: 15936-09-1

Formula: C₈H₆N₂O

Purity: 98%

Color and Shape: Solid

Molecular weight: 146.149

Ref: 10-F236821

1,8-Naphthyridine-2(1H)-one

CAS: 15936-09-1

1,8-Naphthyridine-2(1H)-one is a naphthyridone that inhibits the growth of gram-positive bacteria. This compound binds to the CB2 receptor site on the cell membrane and blocks the transfer of electrons from cytochrome c to molecular oxygen, which inhibits the production of reactive oxygen species. This inhibition causes an accumulation of hydrogen peroxide in the bacterial cell and leads to necrosis. 1,8-Naphthyridine-2(1H)-one has also been shown to inhibit HIV infection by inhibiting reverse transcriptase activity through metal chelate formation.

Formula: C₈H₆N₂O

Purity: Min. 95%

Molecular weight: 146.15 g/mol

Ref: 3D-QAA93609