CymitQuimica logo

CAS 159383-57-0

:

2-Chloro-3-(3-chloropropyl)-6-methoxyquinoline

Description:
2-Chloro-3-(3-chloropropyl)-6-methoxyquinoline is a chemical compound characterized by its quinoline backbone, which is a bicyclic structure containing a benzene ring fused to a pyridine ring. This compound features a chlorine atom at the 2-position and a methoxy group at the 6-position, contributing to its unique reactivity and potential biological activity. The presence of a 3-chloropropyl substituent enhances its lipophilicity, which may influence its interaction with biological membranes and receptors. The methoxy group can also affect the compound's electronic properties and solubility. This compound may exhibit various pharmacological activities, making it of interest in medicinal chemistry. Its structural characteristics suggest potential applications in drug development, particularly in targeting specific biological pathways. However, detailed studies on its toxicity, stability, and specific biological effects would be necessary to fully understand its potential uses and safety profile. As with many halogenated compounds, caution should be exercised regarding environmental impact and regulatory considerations.
Formula:C13H13Cl2NO
InChI:InChI=1S/C13H13Cl2NO/c1-17-11-4-5-12-10(8-11)7-9(3-2-6-14)13(15)16-12/h4-5,7-8H,2-3,6H2,1H3
InChI key:InChIKey=YTYKURZXNARJCD-UHFFFAOYSA-N
SMILES:C(CCCl)C1=CC2=C(N=C1Cl)C=CC(OC)=C2
Synonyms:
  • Quinoline, 2-Chloro-3-(3-Chloropropyl)-6-Methoxy-
  • 2-Chloro-3-(3-chloropropyl)-6-methoxyquinoline
Found 2 products.