CymitQuimica logo

CAS 159435-10-6

:

6-Aminotetramethylrhodamine

Description:
6-Aminotetramethylrhodamine, often abbreviated as TMR or TMR-A, is a fluorescent dye belonging to the rhodamine family, characterized by its vibrant red fluorescence. It is commonly used in various biological and chemical applications, particularly in fluorescence microscopy and flow cytometry due to its high quantum yield and photostability. The compound features a tetramethylrhodamine core structure with an amino group that enhances its solubility in aqueous solutions, making it suitable for labeling biomolecules such as proteins and nucleic acids. Its absorption and emission spectra typically fall within the visible range, allowing for effective detection using standard fluorescence equipment. Additionally, 6-Aminotetramethylrhodamine can be conjugated to other molecules, facilitating its use in targeted imaging and tracking studies in cellular and molecular biology. Safety considerations include handling it with care, as with many organic dyes, due to potential toxicity and environmental impact. Overall, its unique properties make it a valuable tool in scientific research and diagnostics.
Formula:C24H23N3O3
InChI:InChI=1/C24H23N3O3/c1-26(2)15-6-9-18-21(12-15)29-22-13-16(27(3)4)7-10-19(22)24(18)20-11-14(25)5-8-17(20)23(28)30-24/h5-13H,25H2,1-4H3
SMILES:CN(C)c1ccc2c(c1)Oc1cc(ccc1C12c2cc(ccc2C(=O)O1)N)N(C)C
Synonyms:
  • 6-amino-3',6'-bis(dimethylamino)-3H-spiro[2-benzofuran-1,9'-xanthen]-3-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.