CAS 15945-07-0
:2,4,5-Trichlorobenzenesulfonyl chloride
Description:
2,4,5-Trichlorobenzenesulfonyl chloride is an organic compound characterized by its sulfonyl chloride functional group attached to a trichlorobenzene ring. This compound is typically a white to pale yellow solid and is known for its reactivity, particularly due to the presence of the sulfonyl chloride group, which can undergo nucleophilic substitution reactions. It is often used as a reagent in organic synthesis, particularly in the preparation of sulfonamides and other sulfonyl derivatives. The presence of chlorine atoms on the benzene ring enhances its electrophilic character, making it a useful intermediate in various chemical transformations. Additionally, 2,4,5-trichlorobenzenesulfonyl chloride is considered hazardous; it can release toxic gases upon decomposition and should be handled with care in a well-ventilated environment, using appropriate personal protective equipment. Its applications extend to the pharmaceutical industry and agrochemicals, where it serves as a building block for more complex molecules.
Formula:C6H2Cl4O2S
InChI:InChI=1S/C6H2Cl4O2S/c7-3-1-5(9)6(2-4(3)8)13(10,11)12/h1-2H
InChI key:InChIKey=WNVVRCKTQSCPAC-UHFFFAOYSA-N
SMILES:S(Cl)(=O)(=O)C1=C(Cl)C=C(Cl)C(Cl)=C1
Synonyms:- 2,4,5-Trichlorobenzene-1-sulfonyl chloride
- 2,4,5-Trichlorobenzenesulfonyl chloride
- 2,4,5-Trichlorophenylsulfonyl chloride
- Benzenesulfonyl chloride, 2,4,5-trichloro-
- NSC 26958
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
2,4,5-Trichlorobenzenesulfonyl Chloride
CAS:Formula:C6H2Cl4O2SPurity:>98.0%(GC)(T)Color and Shape:White to Almost white powder to crystalMolecular weight:279.942,4,5-Trichlorobenzenesulfonyl chloride, 98%
CAS:<p>This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci</p>Formula:C6H2Cl4O2SPurity:98%Color and Shape:Crystals or powder or crystalline powder, WhiteMolecular weight:279.94Benzenesulfonyl chloride, 2,4,5-trichloro-
CAS:Formula:C6H2Cl4O2SPurity:97%Color and Shape:SolidMolecular weight:279.95592,4,5-Trichlorobenzenesulphonyl chloride
CAS:<p>2,4,5-Trichlorobenzenesulphonyl chloride</p>Purity:98%Molecular weight:279.96g/mol2,4,5-Trichlorobenzenesulfonyl chloride
CAS:2,4,5-Trichlorobenzenesulfonyl chloridePurity:≥98%Molecular weight:279.96g/mol2,4,5-Trichlorobenzenesulfonyl chloride
CAS:<p>TCBSC is a reagent for creating amines, alcohols, and acids in organic synthesis.</p>Formula:C6H2Cl4O2SPurity:98%Color and Shape:SolidMolecular weight:279.96





