CAS 15945-28-5
:Benzoic acid, 3,5-dichloro-4-methoxy-, ethyl ester
Description:
Benzoic acid, 3,5-dichloro-4-methoxy-, ethyl ester, with the CAS number 15945-28-5, is an organic compound characterized by its ester functional group derived from benzoic acid. This compound features a benzene ring substituted with two chlorine atoms at the 3 and 5 positions, a methoxy group (-OCH3) at the 4 position, and an ethyl ester group. The presence of chlorine atoms contributes to its potential biological activity and environmental persistence. The methoxy group enhances its lipophilicity, which can influence its solubility and reactivity. Typically, esters like this compound are known for their pleasant aromas and are often used in fragrances and flavorings. Additionally, the compound may exhibit antimicrobial properties, making it of interest in agricultural and pharmaceutical applications. Its physical properties, such as melting point, boiling point, and solubility, would be influenced by the specific substituents on the benzene ring and the ester group. Safety and handling precautions should be observed due to the presence of chlorine, which can pose health risks.
Formula:C10H10Cl2O3
InChI:InChI=1S/C10H10Cl2O3/c1-3-15-10(13)6-4-7(11)9(14-2)8(12)5-6/h4-5H,3H2,1-2H3
InChI key:InChIKey=VKISJJBQCWTCFE-UHFFFAOYSA-N
SMILES:O(C)C1=C(Cl)C=C(C(OCC)=O)C=C1Cl
Synonyms:- p-Anisic acid, 3,5-dichloro-, ethyl ester
- Benzoic acid, 3,5-dichloro-4-methoxy-, ethyl ester
- 3,5-Dichloro-4-methoxybenzoic acid ethyl ester
- Ethyl 3,5-dichloro-4-methoxybenzoate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Benzoic acid, 3,5-dichloro-4-methoxy-, ethyl ester
CAS:Formula:C10H10Cl2O3Purity:95%Molecular weight:249.0906Ethyl 3,5-dichloro-4-methoxybenzoate
CAS:Ethyl 3,5-dichloro-4-methoxybenzoate is an organic compound that has a variety of uses. It is an intermediate in the synthesis of various other compounds and as a reagent, it reacts with amines to form ureas. Ethyl 3,5-dichloro-4-methoxybenzoate can also be used as a complex building block for synthesizing other compounds. This chemical can be used as a speciality chemical or research chemical. As a versatile building block, ethyl 3,5-dichloro-4-methoxybenzoate can be used to make reaction components for synthesizing polymers or pharmaceuticals.
Formula:C10H10Cl2O3Purity:Min. 95%Color and Shape:PowderMolecular weight:249.09 g/molRef: 3D-FE67180
Discontinued product



