CAS 159518-97-5
:Cloransulam
Description:
Cloransulam is a selective herbicide primarily used in agricultural settings to control a variety of broadleaf weeds and certain grasses. It belongs to the class of sulfonylurea herbicides, which function by inhibiting the enzyme acetolactate synthase (ALS), crucial for the synthesis of branched-chain amino acids in plants. This mechanism leads to the disruption of protein synthesis and ultimately plant death. Cloransulam is characterized by its systemic action, allowing it to be absorbed by plant roots and foliage, providing effective control even in challenging conditions. The compound is typically applied pre-emergence or post-emergence, depending on the target weeds and crop type. It is known for its low toxicity to mammals and birds, making it a relatively safe option when used according to label instructions. Additionally, Cloransulam exhibits good environmental stability, which contributes to its effectiveness in various soil types and climatic conditions. However, as with all herbicides, proper management practices are essential to minimize the risk of resistance development in weed populations.
Formula:C14H11ClFN5O5S
InChI:InChI=1/C14H11ClFN5O5S/c1-2-26-14-17-9(16)6-10-18-13(19-21(10)14)27(24,25)20-11-7(12(22)23)4-3-5-8(11)15/h3-6,20H,2H2,1H3,(H,22,23)
InChI key:InChIKey=YIANBKOBVRMNPR-UHFFFAOYSA-N
SMILES:O(CC)C=1N2C(=NC(S(NC3=C(C(O)=O)C=CC=C3Cl)(=O)=O)=N2)C=C(F)N1
Synonyms:- 3-Chloro-2-[[(5-ethoxy-7-fluoro[1,2,4]triazolo[1,5-c]pyrimidin-2-yl)sulfonyl]amino]benzoic acid
- Benzoic acid, 3-chloro-2-[[(5-ethoxy-7-fluoro[1,2,4]triazolo[1,5-c]pyrimidin-2-yl)sulfonyl]amino]-
- Xde 565
- Cloransulam
- Cloransulam [iso]
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
