CAS 15953-45-4

5-Chloro-3-methylpyrazole

Description:

5-Chloro-3-methylpyrazole is an organic compound characterized by its pyrazole ring structure, which consists of a five-membered ring containing two adjacent nitrogen atoms. This compound features a chlorine atom at the 5-position and a methyl group at the 3-position of the pyrazole ring, contributing to its unique chemical properties. It is typically a white to off-white crystalline solid, and its molecular formula is C4H5ClN2. The presence of the chlorine atom enhances its reactivity, making it useful in various chemical syntheses and applications, particularly in the field of agrochemicals and pharmaceuticals. 5-Chloro-3-methylpyrazole exhibits moderate solubility in organic solvents and is relatively stable under standard conditions. Its reactivity can be attributed to the electron-withdrawing nature of the chlorine substituent, which can influence its behavior in chemical reactions. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.

Formula: C₄H₅ClN₂

InChI: InChI=1/C4H5ClN2/c1-3-2-4(5)7-6-3/h2H,1H3,(H,6,7)

SMILES: Cc1cc(Cl)n[nH]1

Synonyms:

• 5-Chloro-3-Methyl-1H-Pyrazole
• 3-chloro-5-methyl-1H-pyrazole

1H-Pyrazole, 3-chloro-5-methyl-

CAS: 15953-45-4

Formula: C₄H₅ClN₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 116.5489

Ref: IN-DA001R5E

5-Chloro-3-methylpyrazole

CAS: 15953-45-4

5-Chloro-3-methylpyrazole

Purity: 98%

Molecular weight: 116.55g/mol

Ref: 54-OR917576

5-Chloro-3-methyl-1H-pyrazole

CAS: 15953-45-4

Formula: C₄H₅ClN₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 116.55

Ref: 10-F214608