CAS 15953-73-8: 4-chloro-3,5-dimethyl-1H-pyrazole
Description:4-Chloro-3,5-dimethyl-1H-pyrazole is an organic compound characterized by its pyrazole ring structure, which is a five-membered ring containing two nitrogen atoms. This compound features two methyl groups at the 3 and 5 positions and a chlorine atom at the 4 position of the pyrazole ring, contributing to its unique chemical properties. It is typically a solid at room temperature and is known for its potential applications in agricultural chemistry, particularly as a herbicide or fungicide. The presence of the chlorine atom enhances its reactivity and may influence its biological activity. Additionally, the compound's molecular structure allows for various interactions, making it of interest in medicinal chemistry and material science. Its synthesis often involves multi-step organic reactions, and it can be analyzed using techniques such as NMR spectroscopy and mass spectrometry to confirm its identity and purity. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C5H7ClN2
InChI:InChI=1/C5H7ClN2/c1-3-5(6)4(2)8-7-3/h1-2H3,(H,7,8)
- Synonyms:
- 1H-Pyrazole, 4-chloro-3,5-dimethyl-
- 4-Chloro-3,5-dimethyl-1H-pyrazole
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 1H-Pyrazole, 4-chloro-3,5-dimethyl- REF: IN-DA001R5DCAS: 15953-73-8 | 95% | To inquire | Tue 29 Apr 25 |
![]() | 4-Chloro-3,5-dimethyl-1H-pyrazole REF: 54-OR956934CAS: 15953-73-8 | 95% | 32.00 €~2,910.00 € | Mon 28 Apr 25 |
![]() | 4-Chloro-3,5-dimethyl-1H-pyrazole REF: 10-F026201CAS: 15953-73-8 | 95.0% | To inquire | Wed 07 May 25 |
![]() | 4-Chloro-3,5-dimethyl-1H-pyrazole REF: 3D-FC112219CAS: 15953-73-8 | Min. 95% | - - - | Discontinued product |

1H-Pyrazole, 4-chloro-3,5-dimethyl-
Ref: IN-DA001R5D
1g | 77.00 € | ||
5g | 163.00 € | ||
25g | To inquire | ||
250mg | 37.00 € |

Ref: 54-OR956934
1g | 61.00 € | ||
5g | 193.00 € | ||
25g | 865.00 € | ||
100g | 2,910.00 € | ||
250mg | 32.00 € |

4-Chloro-3,5-dimethyl-1H-pyrazole
Ref: 10-F026201
1g | To inquire | ||
5g | To inquire | ||
250mg | 29.00 € |

4-Chloro-3,5-dimethyl-1H-pyrazole
Ref: 3D-FC112219
1g | Discontinued | Request information | |
2g | Discontinued | Request information | |
5g | Discontinued | Request information | |
10g | Discontinued | Request information | |
500mg | Discontinued | Request information |