CymitQuimica logo

CAS 159549-97-0

:

(R)-Benzyl 2-((R)-2-((tert-butoxycarbonyl)amino)-4-methylpentanamido)-3-phenylpropanoate

Description:
(R)-Benzyl 2-((R)-2-((tert-butoxycarbonyl)amino)-4-methylpentanamido)-3-phenylpropanoate is a complex organic compound characterized by its chiral centers and functional groups. It features a benzyl ester moiety, which contributes to its lipophilicity and potential for biological activity. The presence of a tert-butoxycarbonyl (Boc) group indicates that it is likely used in peptide synthesis or as a protecting group for amino acids, enhancing its utility in organic synthesis. The compound's structure includes a 4-methylpentanamido chain, which adds to its steric bulk and may influence its interactions in biological systems. The chiral centers in the molecule suggest that it may exhibit specific stereochemical properties, which can be crucial for its activity in pharmacological applications. Overall, this compound's unique combination of functional groups and stereochemistry makes it a valuable candidate for research in medicinal chemistry and drug development. Its CAS number, 159549-97-0, allows for easy identification and reference in chemical databases.
Formula:C27H36N2O5
InChI:InChI=1S/C27H36N2O5/c1-19(2)16-22(29-26(32)34-27(3,4)5)24(30)28-23(17-20-12-8-6-9-13-20)25(31)33-18-21-14-10-7-11-15-21/h6-15,19,22-23H,16-18H2,1-5H3,(H,28,30)(H,29,32)/t22-,23-/m1/s1
InChI key:IKZFNIAMQFYRSM-DHIUTWEWSA-N
SMILES:CC(C)C[C@H](C(=O)N[C@H](CC1=CC=CC=C1)C(=O)OCC2=CC=CC=C2)NC(=O)OC(C)(C)C
Found 2 products.