CAS 159559-71-4
:(RS)-TRANS-7-HYDROXY-2-[N-PROPYL-N-(3'-IODO-2'-PROPENYL)AMINO]TETRALIN MALEATE
Description:
(RS)-TRANS-7-HYDROXY-2-[N-PROPYL-N-(3'-IODO-2'-PROPENYL)AMINO]TETRALIN MALEATE, with CAS number 159559-71-4, is a chemical compound that belongs to the class of tetralin derivatives. This substance features a complex molecular structure characterized by a tetralin core, which is a bicyclic compound consisting of a benzene ring fused to a cyclohexane ring. The presence of a hydroxyl group at the 7-position and an amino group with a propyl chain and an iodo-substituted propenyl moiety contributes to its unique properties. The maleate salt form indicates that it is combined with maleic acid, which can enhance its solubility and stability. This compound may exhibit biological activity, potentially interacting with specific receptors or enzymes due to its structural features. Its stereochemistry, indicated by the (RS) designation, suggests a racemic mixture of enantiomers, which can influence its pharmacological effects. Overall, this compound's characteristics make it of interest in medicinal chemistry and pharmacology, particularly in the development of therapeutic agents.
Formula:C20H26INO5
InChI:InChI=1/C16H22INO.C4H4O4/c1-2-9-18(10-3-8-17)15-6-4-13-5-7-16(19)12-14(13)11-15;5-3(6)1-2-4(7)8/h3,5,7-8,12,15,19H,2,4,6,9-11H2,1H3;1-2H,(H,5,6)(H,7,8)/b8-3+;2-1-
Synonyms:- 7-Hydroxy-Pipat Maleate
- Trans-7-Hydroxy-2-[N-Propyl-N(3'-Iodo-2'-Propenyl)Amino]Tetralin Maleate
- Trans-7-Hydroxy-Pipat Maleate
- (R,S)-trans-7-Hydroxy-2-(N-propyl-N-(3'-iodo-2'-propenyl)amino)tetralinemaleate
- 3-[[(E)-3-iodoallyl]-propyl-amino]tetralin-6-ol
- Maleic Acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
2-Naphthalenol, 5,6,7,8-tetrahydro-7-[(3-iodo-2-propen-1-yl)propylamino]-
CAS:Formula:C16H22INOMolecular weight:371.25647-Hydroxy-PIPAT maleate
CAS:<p>7-Hydroxy-PIPAT maleate is a D3R agonist.</p>Formula:C16H22INOColor and Shape:SolidMolecular weight:371.262


