CAS 15958-99-3

5'-Deoxyuridine

Description:

5'-Deoxyuridine, also known as deoxyuridine, is a nucleoside that consists of a uracil base attached to a deoxyribose sugar. Its chemical formula is C9H11N2O5, and it is characterized by the absence of a hydroxyl group at the 2' position of the ribose, distinguishing it from ribonucleosides. This compound plays a crucial role in the synthesis of DNA, serving as a building block for the incorporation of uracil into nucleic acids. 5'-Deoxyuridine is typically a white to off-white crystalline powder and is soluble in water, making it suitable for various biochemical applications. It is often used in research settings, particularly in studies related to DNA synthesis and repair mechanisms. Additionally, it has potential therapeutic implications, especially in the context of antiviral and anticancer treatments, as it can influence cellular metabolism and nucleic acid synthesis. Its CAS number, 15958-99-3, is a unique identifier that facilitates the tracking and regulation of this compound in scientific literature and databases.

Formula: C₉H₁₂N₂O₅

InChI: InChI=1/C9H12N2O5/c1-4-6(13)7(14)8(16-4)11-3-2-5(12)10-9(11)15/h2-4,6-8,13-14H,1H3,(H,10,12,15)/t4-,6+,7?,8-/m1/s1

Uridine, 5'-deoxy-

CAS: 15958-99-3

Formula: C₉H₁₂N₂O₅

Purity: 98%

Color and Shape: Solid

Molecular weight: 228.2020

Ref: IN-DA001R6S

1-((2R,3R,4S,5R)-3,4-dihydroxy-5-methyltetrahydrofuran-2-yl)pyrimidine-2,4(1H,3H)-dione

CAS: 15958-99-3

1-((2R,3R,4S,5R)-3,4-dihydroxy-5-methyltetrahydrofuran-2-yl)pyrimidine-2,4(1H,3H)-dione

Purity: 98%

Ref: 54-OR1041024

5'-Deoxyuridine

CAS: 15958-99-3

5'-Deoxyuridine is a Nucleoside Derivative - 5'-Modified nucleoside;5'-Deoxy nucleoside.

Formula: C₉H₁₂N₂O₅

Color and Shape: Solid

Molecular weight: 228.2

Ref: TM-TNU1184

5''-Deoxyuridine

CAS: 15958-99-3

Formula: C₉H₁₂N₂O₅

Purity: ≥ 98.0%

Color and Shape: White to off-white powder

Molecular weight: 228.20

Ref: 7W-GN1624

5'-Deoxyuridine

CAS: 15958-99-3

5'-Deoxyuridine is an inorganic, phosphite, and isomeric compound. It can be used as a chromatographic analog to purify uridylic acid. The epimerization reaction of 5'-deoxyuridine with galactose can be catalyzed by dehydrogenase or ion-exchange resin. In addition, 5'-deoxyuridine has the same chemical formula as uridine (C5H5N3O3) but has a different structure: in place of the hydroxyl group on carbon number 5, it has a hydrogen atom. 5'-Deoxyuridine has two isomers: one with the hydroxyl group on carbon number 4 and another with the hydroxyl group on carbon number 2.

Formula: C₉H₁₂N₂O₅

Purity: Min. 95%

Color and Shape: White Powder

Molecular weight: 228.21 g/mol

Ref: 3D-ND08410

1-((2R,3R,4S,5R)-3,4-dihydroxy-5-methyltetrahydrofuran-2-yl)pyrimidine-2,4(1H,3H)-dione

CAS: 15958-99-3

Purity: 98%

Molecular weight: 228.2039948

Ref: 10-F770500