CAS 159589-67-0

2-(1H-IMIDAZOL-1-YL)BENZOIC ACID

Description:

2-(1H-Imidazol-1-yl)benzoic acid, with the CAS number 159589-67-0, is an organic compound characterized by its dual functional groups: a benzoic acid moiety and an imidazole ring. This compound typically exhibits a white to off-white crystalline appearance and is soluble in polar solvents such as water and alcohols, owing to the presence of the carboxylic acid group. The imidazole ring contributes to its potential biological activity, making it of interest in medicinal chemistry, particularly for its role in drug design and development. The compound may exhibit properties such as antimicrobial or antifungal activity, which are common in imidazole derivatives. Additionally, its ability to form hydrogen bonds enhances its reactivity and interaction with biological targets. The presence of both aromatic and heterocyclic structures in its framework allows for diverse chemical reactivity, making it a valuable compound in various synthetic applications. Overall, 2-(1H-imidazol-1-yl)benzoic acid is a versatile compound with significant implications in both research and pharmaceutical contexts.

Formula: C₁₀H₈N₂O₂

InChI: InChI=1/C10H8N2O2/c13-10(14)8-3-1-2-4-9(8)12-6-5-11-7-12/h1-7H,(H,13,14)

SMILES: c1ccc(c(c1)C(=O)O)n1ccnc1

Synonyms:

• 2-(1H-Imidazol-1-yl)benzoic acid ,97%

Benzoic acid, 2-(1H-imidazol-1-yl)-

CAS: 159589-67-0

Formula: C₁₀H₈N₂O₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 188.1827

Ref: IN-DA001R69

2-(1H-Imidazol-1-yl)benzoic acid

CAS: 159589-67-0

2-(1H-Imidazol-1-yl)benzoic acid

Formula: C₁₀H₈N₂O₂

Purity: ≥95%

Color and Shape: light brown powder

Molecular weight: 188.18g/mol

Ref: 54-OR0715

2-(1H-Imidazol-1-yl)benzoic acid

CAS: 159589-67-0

Formula: C₁₀H₈N₂O₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 188.186

Ref: 10-F446306