
CAS 1596-52-7
:4,6-Dinitroquinoline 1-oxide
Description:
4,6-Dinitroquinoline 1-oxide is a chemical compound characterized by its nitro-substituted quinoline structure. It features two nitro groups located at the 4 and 6 positions of the quinoline ring, along with a 1-oxide functional group, which contributes to its reactivity and properties. This compound is typically a yellow crystalline solid and is known for its use in various chemical applications, including as a reagent in organic synthesis and as a potential intermediate in the production of other chemical entities. It exhibits notable biological activity, which has led to investigations into its potential as an antimicrobial or antitumor agent. The presence of nitro groups enhances its electron-withdrawing characteristics, influencing its reactivity in electrophilic aromatic substitution reactions. Additionally, 4,6-Dinitroquinoline 1-oxide is subject to specific safety and handling precautions due to its potential toxicity and environmental impact. Proper laboratory practices should be followed when working with this compound to mitigate risks associated with its use.
Formula:C9H5N3O5
InChI:InChI=1S/C9H5N3O5/c13-10-4-3-9(12(16)17)7-5-6(11(14)15)1-2-8(7)10/h1-5H
InChI key:InChIKey=QERNYYPEFOVKMT-UHFFFAOYSA-N
SMILES:N(=O)(=O)C=1C2=C(N(=O)=CC1)C=CC(N(=O)=O)=C2
Synonyms:- Quinoline, 4,6-dinitro-, 1-oxide
- 4,6-Dinitroquinoline 1-oxide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
