CAS 159610-82-9
:FMOC-L-STYRYLALANINE
Description:
FMOC-L-styrylalanine is a synthetic amino acid derivative characterized by the presence of a fluorenylmethyloxycarbonyl (FMOC) protective group, which is commonly used in peptide synthesis to protect the amino group of the amino acid. This compound features a styryl group, which is a vinyl-substituted phenyl group, attached to the alpha carbon of the alanine residue, imparting unique properties such as increased hydrophobicity and potential for π-π stacking interactions. FMOC-L-styrylalanine is typically utilized in the field of peptide chemistry and drug design, particularly in the synthesis of peptides with specific structural or functional properties. Its solubility is generally influenced by the presence of the FMOC group, making it soluble in organic solvents while being less soluble in water. The compound's reactivity can be modulated by the protective FMOC group, allowing for selective deprotection under mild conditions, which is advantageous in multi-step synthesis processes. Overall, FMOC-L-styrylalanine serves as a valuable building block in the development of bioactive peptides and materials in medicinal chemistry.
Formula:C26H23NO4
InChI:InChI=1/C26H23NO4/c28-25(29)24(16-8-11-18-9-2-1-3-10-18)27-26(30)31-17-23-21-14-6-4-12-19(21)20-13-5-7-15-22(20)23/h1-15,23-24H,16-17H2,(H,27,30)(H,28,29)/p-1/b11-8+/t24-/m0/s1
Synonyms:- (S)-N-Fmoc-Styrylalanine
- (S)-N-(9-Fluorenylmethoxycarbonyl)-2-Amino-5-Phenyl-4-Pentenoic Acid
- (S)-2-(Fmoc-Amino)-5-Phenyl-4-Pentenoic Acid
- Rarechem Bk Pt 0179
- N-Alpha-(9-Fluorenylmethoxycarbonyl)-2-Styryl-L-Alanine
- Fmoc-3-Styryl-L-Alanine
- Fmoc-Ala(Styr)-Oh
- (2S,4E)-2-{[(9H-fluoren-9-ylmethoxy)carbonyl]amino}-5-phenylpent-4-enoate
- (2S,4E)-2-{[(9H-fluoren-9-ylmethoxy)carbonyl]amino}-5-phenylpent-4-enoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
4-Pentenoic acid, 2-[[(9H-fluoren-9-ylmethoxy)carbonyl]amino]-5-phenyl-, [S-(E)]- (9CI)
CAS:Formula:C26H23NO4Purity:98%Color and Shape:SolidMolecular weight:413.4651(S,E)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-5-phenylpent-4-enoic acid
CAS:(S,E)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-5-phenylpent-4-enoic acidPurity:98%Molecular weight:413.47g/mol(S,E)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-5-phenylpent-4-enoic acid
CAS:Purity:97%Molecular weight:413.4729919



