
CAS 159634-54-5
:2-Amino-N-[(1R)-1-[[1,2-dihydro-1-(methylsulfonyl)spiro[3H-indole-3,4′-piperidin]-1′-yl]carbonyl]-4-phenylbutyl]-2-methylpropanamide
Description:
2-Amino-N-[(1R)-1-[[1,2-dihydro-1-(methylsulfonyl)spiro[3H-indole-3,4′-piperidin]-1′-yl]carbonyl]-4-phenylbutyl]-2-methylpropanamide, with CAS number 159634-54-5, is a complex organic compound characterized by its intricate molecular structure, which includes multiple functional groups such as an amine, a sulfonyl group, and a carbonyl moiety. This compound is notable for its potential pharmacological applications, particularly in the field of medicinal chemistry, where it may exhibit activity against specific biological targets. The presence of a spiro-indole structure suggests possible interactions with various receptors or enzymes, making it a candidate for further investigation in drug development. Its solubility, stability, and reactivity would depend on the specific conditions and solvents used, as well as the pH of the environment. Additionally, the compound's stereochemistry, indicated by the (1R) configuration, plays a crucial role in its biological activity and interactions. Overall, this substance represents a significant area of interest for researchers exploring novel therapeutic agents.
Formula:C28H38N4O4S
InChI:InChI=1S/C28H38N4O4S/c1-27(2,29)26(34)30-23(14-9-12-21-10-5-4-6-11-21)25(33)31-18-16-28(17-19-31)20-32(37(3,35)36)24-15-8-7-13-22(24)28/h4-8,10-11,13,15,23H,9,12,14,16-20,29H2,1-3H3,(H,30,34)/t23-/m1/s1
InChI key:InChIKey=BKQCTMOROFZQNH-HSZRJFAPSA-N
SMILES:S(C)(=O)(=O)N1CC2(C=3C1=CC=CC3)CCN(C([C@@H](CCCC4=CC=CC=C4)NC(C(C)(C)N)=O)=O)CC2
Synonyms:- 2-Amino-N-[(1R)-1-[[1,2-dihydro-1-(methylsulfonyl)spiro[3H-indole-3,4′-piperidin]-1′-yl]carbonyl]-4-phenylbutyl]-2-methylpropanamide
- Propanamide, 2-amino-N-[(1R)-1-[[1,2-dihydro-1-(methylsulfonyl)spiro[3H-indole-3,4′-piperidin]-1′-yl]carbonyl]-4-phenylbutyl]-2-methyl-
- Propanamide, 2-amino-N-[1-[[1,2-dihydro-1-(methylsulfonyl)spiro[3H-indole-3,4′-piperidin]-1′-yl]carbonyl]-4-phenylbutyl]-2-methyl-, (R)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
L 163255
CAS:L 163255 is a type of growth hormone secretagogue (GHS).Formula:C28H38N4O4SColor and Shape:SolidMolecular weight:526.69
