CAS 15969-10-5

2-bromo-4-chloro-6-nitro-phenol

Description:

2-Bromo-4-chloro-6-nitro-phenol is an organic compound characterized by the presence of a phenolic ring substituted with three distinct groups: a bromine atom, a chlorine atom, and a nitro group. This compound is typically a solid at room temperature and exhibits a yellow to brown coloration. It is known for its potential applications in various fields, including pharmaceuticals and agrochemicals, due to its reactivity and ability to participate in further chemical transformations. The presence of the nitro group contributes to its electron-withdrawing properties, which can influence its acidity and reactivity in electrophilic aromatic substitution reactions. Additionally, the halogen substituents (bromine and chlorine) can enhance the compound's biological activity and stability. As with many halogenated compounds, 2-bromo-4-chloro-6-nitro-phenol may pose environmental and health risks, necessitating careful handling and disposal in accordance with safety regulations. Its specific physical and chemical properties, such as solubility and melting point, can vary based on purity and environmental conditions.

Formula: C₆H₃BrClNO₃

InChI: InChI=1/C6H3BrClNO3/c7-4-1-3(8)2-5(6(4)10)9(11)12/h1-2,10H

SMILES: c1c(cc(c(c1Br)O)N(=O)=O)Cl

Synonyms:

• Phenol, 2-broMo-4-chloro-6-nitro-

Phenol, 2-bromo-4-chloro-6-nitro-

CAS: 15969-10-5

Formula: C₆H₃BrClNO₃

Purity: 97%

Color and Shape: Solid

Molecular weight: 252.4499

Ref: IN-DA001RBL

2-Bromo-4-chloro-6-nitrophenol

CAS: 15969-10-5

2-Bromo-4-chloro-6-nitrophenol

Purity: 98%

Molecular weight: 252.45g/mol

Ref: 54-OR90060

2-bromo-4-chloro-6-nitrophenol

CAS: 15969-10-5

Formula: C₆H₃BrClNO₃

Purity: 97%

Color and Shape: Solid

Molecular weight: 252.45

Ref: 10-F350328

2-Bromo-4-chloro-6-nitrophenol

Controlled Product

CAS: 15969-10-5

Applications 2-Bromo-4-chloro-6-nitrophenol

Formula: C₆H₃BrClNO₃

Color and Shape: Neat

Molecular weight: 252.45

Ref: TR-B684523